1-[5-(4'-Chloro-biphenyl-4-yloxy)-hexyl]-3-pyridin-4-yl-imidazolidin-2-one

ID: ALA371590

PubChem CID: 5278481

Max Phase: Preclinical

Molecular Formula: C26H28ClN3O2

Molecular Weight: 449.98

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(CCCCN1CCN(c2ccncc2)C1=O)Oc1ccc(-c2ccc(Cl)cc2)cc1

Standard InChI:  InChI=1S/C26H28ClN3O2/c1-20(32-25-11-7-22(8-12-25)21-5-9-23(27)10-6-21)4-2-3-17-29-18-19-30(26(29)31)24-13-15-28-16-14-24/h5-16,20H,2-4,17-19H2,1H3

Standard InChI Key:  SFQIZOIUPPVGIA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    1.1167   -2.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7917   -3.4500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9417   -2.7750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4042   -3.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0208   -3.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7042   -1.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1167   -3.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6917   -2.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5167   -2.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6250   -3.9792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.2625   -1.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3042   -3.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9500   -3.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9042   -1.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2167   -2.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0417   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1667   -2.6292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2625   -4.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5708   -3.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4292   -2.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4750   -3.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7292   -1.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7667   -3.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9917   -2.6042    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.6542   -2.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3750   -3.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0625   -4.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042   -2.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3667   -2.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7917   -2.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5042   -1.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0792   -2.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  1  0
  4  2  1  0
  5  2  1  0
  6  1  2  0
  7  3  1  0
  8 12  1  0
  9  8  1  0
 10 26  2  0
 11 20  1  0
 12 21  2  0
 13  9  2  0
 14  9  1  0
 15 28  1  0
 16 15  1  0
 17 22  1  0
 18  5  1  0
 19  5  2  0
 20 16  2  0
 21 16  1  0
 22 14  2  0
 23 13  1  0
 24 17  1  0
 25  3  1  0
 26 19  1  0
 27 18  2  0
 28 30  1  0
 29 25  1  0
 30 32  1  0
 31 28  1  0
 32 29  1  0
  4  7  1  0
 27 10  1  0
  8 11  2  0
 23 17  2  0
M  END

Associated Targets(non-human)

Enterovirus (1116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 449.98Molecular Weight (Monoisotopic): 449.1870AlogP: 6.28#Rotatable Bonds: 9
Polar Surface Area: 45.67Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.48CX LogP: 5.13CX LogD: 5.13
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.15

References

1. Chang CS, Lin YT, Shih SR, Lee CC, Lee YC, Tai CL, Tseng SN, Chern JH..  (2005)  Design, synthesis, and antipicornavirus activity of 1-[5-(4-arylphenoxy)alkyl]-3-pyridin-4-ylimidazolidin-2-one derivatives.,  48  (10): [PMID:15887961] [10.1021/jm050033v]

Source