(4-(3-(cyclopropylamino)quinoxalin-2-yl)piperazin-1-yl)(4-(methylsulfonyl)phenyl)methanone 2,2,2-trifluoroacetic acid

ID: ALA3716133

PubChem CID: 127024202

Max Phase: Preclinical

Molecular Formula: C25H26F3N5O5S

Molecular Weight: 451.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)c1ccc(C(=O)N2CCN(c3nc4ccccc4nc3NC3CC3)CC2)cc1.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C23H25N5O3S.C2HF3O2/c1-32(30,31)18-10-6-16(7-11-18)23(29)28-14-12-27(13-15-28)22-21(24-17-8-9-17)25-19-4-2-3-5-20(19)26-22;3-2(4,5)1(6)7/h2-7,10-11,17H,8-9,12-15H2,1H3,(H,24,25);(H,6,7)

Standard InChI Key:  BNAOFHUQQRNIPS-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
    7.6928    0.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3928    0.8927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3928    2.0927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3534    0.2930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7323    0.7424    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7320   -0.4575    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.6928   -1.0573    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0383    1.3229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9962    0.7279    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9909   -0.4721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8096    3.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9091   -1.5019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9086    1.5029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9097    3.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2093    3.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5078    3.0010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5067    1.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2071    0.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1077    2.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9067   -3.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4100    3.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7059    2.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6996    1.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3975    0.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1016    1.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8125    4.9478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0327    0.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6522   -4.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1522   -4.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  1  0
  1  7  1  0
  9  8  2  0
 10  9  2  0
 12 13  2  0
 13 14  1  0
 14 17  2  0
 16 15  2  0
 15 12  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 22  1  0
 12 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 26 11  1  0
 11 29  1  0
 22 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 29  1  0
 11 36  2  0
 33  9  1  0
  9 37  1  0
 38 30  1  0
 39 38  1  0
 30 39  1  0
M  END

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.55Molecular Weight (Monoisotopic): 451.1678AlogP: 2.57#Rotatable Bonds: 5
Polar Surface Area: 95.50Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.16CX LogP: 2.30CX LogD: 2.30
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.64Np Likeness Score: -1.66

References

1.  (2014)  Quinoxaline derivatives as gpr6 modulators, 
2.  (2015)  Quinoxaline derivatives as gpr6 modulators, 

Source