(4-(3-(cyclopropylamino)quinoxalin-2-yl)piperazin-1-yl)(3,4-dichlorophenyl)methanone 2,2,2-trifluoroacetic acid

ID: ALA3716194

PubChem CID: 127024204

Max Phase: Preclinical

Molecular Formula: C24H22Cl2F3N5O3

Molecular Weight: 442.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)C(F)(F)F.O=C(c1ccc(Cl)c(Cl)c1)N1CCN(c2nc3ccccc3nc2NC2CC2)CC1

Standard InChI:  InChI=1S/C22H21Cl2N5O.C2HF3O2/c23-16-8-5-14(13-17(16)24)22(30)29-11-9-28(10-12-29)21-20(25-15-6-7-15)26-18-3-1-2-4-19(18)27-21;3-2(4,5)1(6)7/h1-5,8,13,15H,6-7,9-12H2,(H,25,26);(H,6,7)

Standard InChI Key:  PMDAMFBCJQEURR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    7.6928    0.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3928    0.8927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3928    2.0927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3534    0.2930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7323    0.7424    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7320   -0.4575    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.6928   -1.0573    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8096    3.7478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9091   -1.5019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9086    1.5029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9097    3.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2093    3.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5078    3.0010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5067    1.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2071    0.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1077    2.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9067   -3.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4100    3.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7059    2.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6996    1.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3975    0.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1016    1.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8125    4.9478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6522   -4.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1522   -4.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3925   -0.4608    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  -12.7363    0.8794    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  1  0
  1  7  1  0
  9 10  2  0
 10 11  1  0
 11 14  2  0
 13 12  2  0
 12  9  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 10 19  1  0
  9 20  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23  8  1  0
  8 26  1  0
 19 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
  8 33  2  0
 34 27  1  0
 35 34  1  0
 27 35  1  0
 31 36  1  0
 30 37  1  0
M  END

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 442.35Molecular Weight (Monoisotopic): 441.1123AlogP: 4.47#Rotatable Bonds: 4
Polar Surface Area: 61.36Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.16CX LogP: 4.67CX LogD: 4.67
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.73

References

1.  (2014)  Quinoxaline derivatives as gpr6 modulators, 
2.  (2015)  Quinoxaline derivatives as gpr6 modulators, 

Source