The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(3-(cyclopropylamino)quinoxalin-2-yl)piperazin-1-yl)(3,4-dichlorophenyl)methanone 2,2,2-trifluoroacetic acid ID: ALA3716194
PubChem CID: 127024204
Max Phase: Preclinical
Molecular Formula: C24H22Cl2F3N5O3
Molecular Weight: 442.35
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)C(F)(F)F.O=C(c1ccc(Cl)c(Cl)c1)N1CCN(c2nc3ccccc3nc2NC2CC2)CC1
Standard InChI: InChI=1S/C22H21Cl2N5O.C2HF3O2/c23-16-8-5-14(13-17(16)24)22(30)29-11-9-28(10-12-29)21-20(25-15-6-7-15)26-18-3-1-2-4-19(18)27-21;3-2(4,5)1(6)7/h1-5,8,13,15H,6-7,9-12H2,(H,25,26);(H,6,7)
Standard InChI Key: PMDAMFBCJQEURR-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
7.6928 0.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3928 0.8927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3928 2.0927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3534 0.2930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7323 0.7424 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.7320 -0.4575 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.6928 -1.0573 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.8096 3.7478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9086 1.5029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9097 3.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2093 3.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5078 3.0010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.5067 1.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2071 0.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1077 2.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9067 -3.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4100 3.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7059 2.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6996 1.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3975 0.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1016 1.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8125 4.9478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6522 -4.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1522 -4.2076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3925 -0.4608 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-12.7363 0.8794 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
1 5 1 0
1 6 1 0
1 7 1 0
9 10 2 0
10 11 1 0
11 14 2 0
13 12 2 0
12 9 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
10 19 1 0
9 20 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 8 1 0
8 26 1 0
19 27 1 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
8 33 2 0
34 27 1 0
35 34 1 0
27 35 1 0
31 36 1 0
30 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.35Molecular Weight (Monoisotopic): 441.1123AlogP: 4.47#Rotatable Bonds: 4Polar Surface Area: 61.36Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.16CX LogP: 4.67CX LogD: 4.67Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: -1.73
References 1. (2014) Quinoxaline derivatives as gpr6 modulators, 2. (2015) Quinoxaline derivatives as gpr6 modulators,