O-Benzyl-N-{[2-(4-chlorophenyl)imidazo[1,2-a]pyridin-6-yl]carbonyl}tyrosine

ID: ALA3716265

PubChem CID: 59335807

Max Phase: Preclinical

Molecular Formula: C30H24ClN3O4

Molecular Weight: 525.99

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)O)c1ccc2nc(-c3ccc(Cl)cc3)cn2c1

Standard InChI:  InChI=1S/C30H24ClN3O4/c31-24-11-8-22(9-12-24)27-18-34-17-23(10-15-28(34)32-27)29(35)33-26(30(36)37)16-20-6-13-25(14-7-20)38-19-21-4-2-1-3-5-21/h1-15,17-18,26H,16,19H2,(H,33,35)(H,36,37)

Standard InChI Key:  RJKOUWKUQCNQLF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0896    0.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9234    1.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4199    1.1671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0791   -0.1803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2418   -1.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7453   -1.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2762   -0.2625    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.6187   -1.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6267   -2.9927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6549   -0.8867    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9300   -3.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2275   -2.9826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2689   -3.5789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2235   -1.7827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9380   -5.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2413   -5.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2516   -7.4820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5557   -8.2232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8496   -7.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8394   -5.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5354   -5.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1559   -8.2034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4495   -7.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7558   -8.1812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0498   -7.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.3539   -8.1637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.3641   -9.6636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0702  -10.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.7661   -9.6813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  8 10  1  0
 13 16  1  0
  3 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 20 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 28 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 33  1  0
M  END

Associated Targets(Human)

GPR34 Tchem Probable G-protein coupled receptor 34 (197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.99Molecular Weight (Monoisotopic): 525.1455AlogP: 5.66#Rotatable Bonds: 9
Polar Surface Area: 92.93Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.41CX Basic pKa: 5.14CX LogP: 4.32CX LogD: 2.46
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -1.22

References

1.  (2010)  Regulating agent of GPR34 receptor function, 

Source