5-(4-Methoxyphenyl)-3-(pyridin-2-yl)pyrazolo[1,5-a]pyrimidin-7(4H)-one

ID: ALA3716647

PubChem CID: 70925473

Max Phase: Preclinical

Molecular Formula: C18H14N4O2

Molecular Weight: 318.34

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc(=O)n3ncc(-c4ccccn4)c3[nH]2)cc1

Standard InChI:  InChI=1S/C18H14N4O2/c1-24-13-7-5-12(6-8-13)16-10-17(23)22-18(21-16)14(11-20-22)15-4-2-3-9-19-15/h2-11,21H,1H3

Standard InChI Key:  FUERVLBQOQMQRF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9991    2.7132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1852   -2.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6221   -3.0405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9838   -4.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9039   -5.5373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4624   -5.1227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1007   -3.6669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168   -1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6203   -2.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2150   -1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9143   -0.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2184   -2.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9210   -3.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5183   -3.7395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5193   -4.9395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  4  1  0
  5  1  1  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  1 10  2  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  7 11  1  0
  3 17  1  0
 17 18  2  0
 18 22  1  0
 21 19  1  0
 19 20  2  0
 20 17  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
M  END

Associated Targets(Human)

CSNK2A2 Tchem Casein kinase II alpha (prime) (1587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 318.34Molecular Weight (Monoisotopic): 318.1117AlogP: 2.76#Rotatable Bonds: 3
Polar Surface Area: 72.28Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.97CX Basic pKa: 3.20CX LogP: 2.06CX LogD: 2.06
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.63Np Likeness Score: -1.30

References

1.  (2012)  Heterocyclic compounds for the inhibition of pask, 
2.  (2012)  Heterocyclic compounds for the inhibition of pask, 

Source