2-[3-Methyl-2-((E)-pent-1-enyl)-benzoylamino]-indan-2-carboxylic acid

ID: ALA3716747

PubChem CID: 25159485

Max Phase: Preclinical

Molecular Formula: C23H25NO3

Molecular Weight: 363.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC/C=C/c1c(C)cccc1C(=O)NC1(C(=O)O)Cc2ccccc2C1

Standard InChI:  InChI=1S/C23H25NO3/c1-3-4-5-12-19-16(2)9-8-13-20(19)21(25)24-23(22(26)27)14-17-10-6-7-11-18(17)15-23/h5-13H,3-4,14-15H2,1-2H3,(H,24,25)(H,26,27)/b12-5+

Standard InChI Key:  MXEZMFDQDAPMOI-LFYBBSHMSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8638   -6.4609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6020   -5.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8404   -3.8629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3404   -3.8764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5809   -2.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3214   -1.2765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3809   -2.5907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3030    1.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6951    2.3582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5030    1.3331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3638   -6.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6022   -5.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7732   -7.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1014   -5.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3647   -6.5064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1361   -6.5231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8728   -7.8306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0728   -7.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2 18  1  0
 17  3  1  0
  3  1  1  0
 14  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7 15  2  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
  9  1  1  0
  1 11  1  0
 11 12  1  0
 11 13  2  0
 14 15  1  0
 14 16  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 15 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
M  END

Associated Targets(Human)

CXCR5 Tchem C-X-C chemokine receptor type 5 (187 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 363.46Molecular Weight (Monoisotopic): 363.1834AlogP: 4.16#Rotatable Bonds: 6
Polar Surface Area: 66.40Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.79CX Basic pKa: CX LogP: 5.39CX LogD: 2.13
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.81Np Likeness Score: -0.02

References

1.  (2010)  Substituted benzoylamino-indan-2-carboxylic acids and related compounds, 

Source