4'-ethyl-N-{2-oxo-2-[(1-phenylpropyl)amino]ethyl}biphenyl-4-carboxamide

ID: ALA3716774

PubChem CID: 58965390

Max Phase: Preclinical

Molecular Formula: C26H28N2O2

Molecular Weight: 400.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCc1ccc(-c2ccc(C(=O)NCC(=O)NC(CC)c3ccccc3)cc2)cc1

Standard InChI:  InChI=1S/C26H28N2O2/c1-3-19-10-12-20(13-11-19)21-14-16-23(17-15-21)26(30)27-18-25(29)28-24(4-2)22-8-6-5-7-9-22/h5-17,24H,3-4,18H2,1-2H3,(H,27,30)(H,28,29)

Standard InChI Key:  UXGKCQZWBHGMBU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5972   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8999   -0.7576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9372   -1.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951   -3.0039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9336   -3.1588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1894   -6.0109    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1872   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4854   -8.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1469   -8.1099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4855   -9.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7845  -10.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0836   -9.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0836   -8.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7846   -7.5149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3832  -10.5153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3857  -12.0154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6859  -12.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9837  -12.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9814  -10.5114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6812   -9.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2862  -12.7571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.3236  -12.1540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 16  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 20 23  1  0
 26 29  1  0
 29 30  1  0
M  END

Associated Targets(Human)

TAOK1 Tchem Serine/threonine-protein kinase TAO1 (2019 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TAOK3 Tchem Serine/threonine-protein kinase TAO3 (1005 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.52Molecular Weight (Monoisotopic): 400.2151AlogP: 4.91#Rotatable Bonds: 8
Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.78CX Basic pKa: CX LogP: 5.21CX LogD: 5.21
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.06

References

1.  (2007)  Tao Kinase Modulators And Method Of Use, 

Source