The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-Benzyl-N-{[6-(benzylthio)imidazo[1,2-b]pyridazine-2-yl]carbonyl}tyrosine ID: ALA3716821
PubChem CID: 59335886
Max Phase: Preclinical
Molecular Formula: C30H26N4O4S
Molecular Weight: 538.63
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)O)c1cn2nc(SCc3ccccc3)ccc2n1
Standard InChI: InChI=1S/C30H26N4O4S/c35-29(26-18-34-27(31-26)15-16-28(33-34)39-20-23-9-5-2-6-10-23)32-25(30(36)37)17-21-11-13-24(14-12-21)38-19-22-7-3-1-4-8-22/h1-16,18,25H,17,19-20H2,(H,32,35)(H,36,37)
Standard InChI Key: OZXCXDNEHYFUFQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7008 -0.9930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 1.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0552 2.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0916 0.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2915 0.0970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5559 2.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2911 4.0047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7910 4.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5558 2.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8207 1.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3208 1.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0566 2.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8199 1.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3207 1.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0856 0.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5855 0.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3206 1.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5558 2.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0559 2.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5072 -0.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 -1.4919 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 -2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 -3.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9402 -5.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2443 -5.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5383 -5.2194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5281 -3.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2240 -2.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
8 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
15 16 2 0
14 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
15 31 1 0
2 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.63Molecular Weight (Monoisotopic): 538.1675AlogP: 5.03#Rotatable Bonds: 11Polar Surface Area: 105.82Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.06CX Basic pKa: 0.24CX LogP: 6.23CX LogD: 2.76Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.23Np Likeness Score: -1.17
References 1. (2010) Regulating agent of GPR34 receptor function,