The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-oxo-3-{[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl]amino}-1-phenylpropyl)benzamide ID: ALA3717117
PubChem CID: 69519614
Max Phase: Preclinical
Molecular Formula: C28H29N3O3
Molecular Weight: 455.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CC(NC(=O)c1ccccc1)c1ccccc1)NCC(=O)NC1CCCc2ccccc21
Standard InChI: InChI=1S/C28H29N3O3/c32-26(29-19-27(33)30-24-17-9-15-20-10-7-8-16-23(20)24)18-25(21-11-3-1-4-12-21)31-28(34)22-13-5-2-6-14-22/h1-8,10-14,16,24-25H,9,15,17-19H2,(H,29,32)(H,30,33)(H,31,34)
Standard InChI Key: UBJQFSYLHHPXKB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2995 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 3.7467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6385 3.1449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 5.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9042 5.9961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9073 7.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8691 8.0987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2082 8.2455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2112 9.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5121 10.4948 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5151 11.9957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4770 12.5975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8160 12.7442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9129 10.4989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9133 11.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6146 12.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3152 12.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3147 10.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6134 9.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8212 14.2443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1229 14.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4193 14.2353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4141 12.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1125 11.9898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
19 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
23 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.56Molecular Weight (Monoisotopic): 455.2209AlogP: 3.86#Rotatable Bonds: 8Polar Surface Area: 87.30Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.92CX Basic pKa: ┄CX LogP: 3.57CX LogD: 3.57Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.48Np Likeness Score: -0.86
References 1. (2007) Tao Kinase Modulators And Method Of Use,