3-(4-Chlorobenzyl)-5-(4-isopropoxyphenyl)-2-methylpyrazolo[1,5-a]pyrimidin-7(4H)-one

ID: ALA3717587

PubChem CID: 70925390

Max Phase: Preclinical

Molecular Formula: C23H22ClN3O2

Molecular Weight: 407.90

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn2c(=O)cc(-c3ccc(OC(C)C)cc3)[nH]c2c1Cc1ccc(Cl)cc1

Standard InChI:  InChI=1S/C23H22ClN3O2/c1-14(2)29-19-10-6-17(7-11-19)21-13-22(28)27-23(25-21)20(15(3)26-27)12-16-4-8-18(24)9-5-16/h4-11,13-14,25H,12H2,1-3H3

Standard InChI Key:  SEOZZTGAEFZRNA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9991    2.7132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168   -1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6203   -2.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9143   -0.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9210   -3.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2150   -1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2184   -2.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7889    0.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6552   -2.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1295   -4.3524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5991   -4.6533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5944   -3.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1201   -2.1080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6506   -1.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7700   -3.7717    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -7.5214   -3.7341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8184   -2.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8602   -3.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8136   -1.7789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  1 10  2  0
  3 11  1  0
 11 12  2  0
 12 14  1  0
 15 13  2  0
 13 11  1  0
 16 14  2  0
 15 16  1  0
  8 17  1  0
  7 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 16 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
M  END

Associated Targets(Human)

CSNK2A2 Tchem Casein kinase II alpha (prime) (1587 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.90Molecular Weight (Monoisotopic): 407.1401AlogP: 5.03#Rotatable Bonds: 5
Polar Surface Area: 59.39Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.34CX Basic pKa: 0.58CX LogP: 4.85CX LogD: 4.85
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: -1.23

References

1.  (2012)  Heterocyclic compounds for the inhibition of pask, 
2.  (2012)  Heterocyclic compounds for the inhibition of pask, 

Source