2-[({4-[(3-Aminobenzyl)oxy]phenyl}acetyl)amino]-5-(4-chlorophenyl)indan-2-carboxylic acid

ID: ALA3718198

PubChem CID: 59335799

Max Phase: Preclinical

Molecular Formula: C31H27ClN2O4

Molecular Weight: 527.02

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1cccc(COc2ccc(CC(=O)NC3(C(=O)O)Cc4ccc(-c5ccc(Cl)cc5)cc4C3)cc2)c1

Standard InChI:  InChI=1S/C31H27ClN2O4/c32-26-10-8-22(9-11-26)23-6-7-24-17-31(30(36)37,18-25(24)16-23)34-29(35)15-20-4-12-28(13-5-20)38-19-21-2-1-3-27(33)14-21/h1-14,16H,15,17-19,33H2,(H,34,35)(H,36,37)

Standard InChI Key:  DETFYOMDQNLVQC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168   -1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6203   -2.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9210   -3.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2184   -2.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2150   -1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9143   -0.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3026    1.3234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3218   -1.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7288   -2.3200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5217   -1.2689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5434    2.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2841    3.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3434    2.6094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5249    5.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2633    6.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5019    7.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0019    7.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2635    6.4971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0249    5.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2374    9.0942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2633    9.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0279   10.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5278   10.3571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2893   11.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5508   12.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0509   12.9684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2894   11.6760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2590   -3.5870    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.4601   14.0129    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  2 10  1  0
  8 16  1  0
  8 17  1  0
 17 18  1  0
 17 19  2  0
 16 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 26 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 13 37  1  0
 35 38  1  0
M  END

Associated Targets(Human)

GPR34 Tchem Probable G-protein coupled receptor 34 (197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 527.02Molecular Weight (Monoisotopic): 526.1659AlogP: 5.45#Rotatable Bonds: 8
Polar Surface Area: 101.65Molecular Species: ACIDHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.54CX Basic pKa: 4.23CX LogP: 5.05CX LogD: 2.54
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.26Np Likeness Score: -0.67

References

1.  (2010)  Regulating agent of GPR34 receptor function, 

Source