5-(4-Chlorophenyl)-2-({[4-(3-thienylmethoxy)phenyl]acetyl}amino)indan-2-carboxylic acid

ID: ALA3718234

PubChem CID: 59335750

Max Phase: Preclinical

Molecular Formula: C29H24ClNO4S

Molecular Weight: 518.03

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Cc1ccc(OCc2ccsc2)cc1)NC1(C(=O)O)Cc2ccc(-c3ccc(Cl)cc3)cc2C1

Standard InChI:  InChI=1S/C29H24ClNO4S/c30-25-7-5-21(6-8-25)22-3-4-23-15-29(28(33)34,16-24(23)14-22)31-27(32)13-19-1-9-26(10-2-19)35-17-20-11-12-36-18-20/h1-12,14,18H,13,15-17H2,(H,31,32)(H,33,34)

Standard InChI Key:  YZBHAGQOPQAVNB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168   -1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6203   -2.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9210   -3.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2184   -2.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2150   -1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9143   -0.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2590   -3.5870    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.3026    1.3234    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3218   -1.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7288   -2.3200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5217   -1.2689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5434    2.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2841    3.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3434    2.6094    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5249    5.2179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2633    6.5236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5019    7.8159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0019    7.8027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2635    6.4971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0249    5.2047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2374    9.0942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2633    9.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0279   10.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5099   10.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8347   11.9595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5423   12.7209    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4188   11.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  2 10  1  0
 13 16  1  0
  8 17  1  0
  8 18  1  0
 18 19  1  0
 18 20  2  0
 17 21  1  0
 21 22  1  0
 21 23  2  0
 22 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 27 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  1  0
 36 32  2  0
M  END

Associated Targets(Human)

GPR34 Tchem Probable G-protein coupled receptor 34 (197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.03Molecular Weight (Monoisotopic): 517.1115AlogP: 5.93#Rotatable Bonds: 8
Polar Surface Area: 75.63Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.69CX Basic pKa: CX LogP: 6.45CX LogD: 3.14
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.30Np Likeness Score: -1.06

References

1.  (2010)  Regulating agent of GPR34 receptor function, 

Source