O-Benzyl-N-{[3-chloro-6-(4-chlorophenyl)imidazo[1,2-a]pyridin-2-yl]carbonyl}tyrosine

ID: ALA3718263

PubChem CID: 59335907

Max Phase: Preclinical

Molecular Formula: C30H23Cl2N3O4

Molecular Weight: 560.44

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)O)c1nc2ccc(-c3ccc(Cl)cc3)cn2c1Cl

Standard InChI:  InChI=1S/C30H23Cl2N3O4/c31-23-11-8-21(9-12-23)22-10-15-26-34-27(28(32)35(26)17-22)29(36)33-25(30(37)38)16-19-6-13-24(14-7-19)39-18-20-4-2-1-3-5-20/h1-15,17,25H,16,18H2,(H,33,36)(H,37,38)

Standard InChI Key:  WTFGOZAIRGFZIW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7008   -0.9930    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8208    1.3475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3215    1.3677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0552    2.6770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0916    0.0795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2915    0.0970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5559    2.6972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2911    4.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7910    4.0219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5558    2.7315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8207    1.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3208    1.4068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0566    2.7456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8199    1.4534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3207    1.4674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0856    0.1771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5855    0.1942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3206    1.5017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5558    2.7921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0559    2.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168   -1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6203   -2.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9210   -3.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2184   -2.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2150   -1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9143   -0.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2590   -3.5870    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    6.5072   -0.9685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -2.3426    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
  8 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 15 16  2  0
 14 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
  2 31  1  0
 34 37  1  0
 15 38  1  0
  7 39  1  0
M  END

Associated Targets(Human)

GPR34 Tchem Probable G-protein coupled receptor 34 (197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.44Molecular Weight (Monoisotopic): 559.1066AlogP: 6.31#Rotatable Bonds: 9
Polar Surface Area: 92.93Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.56CX Basic pKa: 2.14CX LogP: 5.88CX LogD: 2.69
Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.22Np Likeness Score: -0.90

References

1.  (2010)  Regulating agent of GPR34 receptor function, 

Source