(E)-(1R,4S,5R,9R,11S,12S)-5-Isopropyl-1-methoxy-8,12-dimethyl-11-[(E)-3-(1-methyl-1H-imidazol-4-yl)-acryloyloxy]-15-oxa-tricyclo[10.2.1.0*4,9*]pentadeca-2,7,13-triene-2-carboxylic acid propyl ester

ID: ALA371830

Cas Number: 216317-77-0

PubChem CID: 9807269

Max Phase: Preclinical

Molecular Formula: C31H42N2O6

Molecular Weight: 538.69

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCOC(=O)/C1=C/[C@@H]2[C@@H](C(C)C)CC=C(C)[C@@H]2C[C@H](OC(=O)/C=C/c2cn(C)cn2)[C@]2(C)C=C[C@@]1(OC)O2

Standard InChI:  InChI=1S/C31H42N2O6/c1-8-15-37-29(35)26-16-25-23(20(2)3)11-9-21(4)24(25)17-27(30(5)13-14-31(26,36-7)39-30)38-28(34)12-10-22-18-33(6)19-32-22/h9-10,12-14,16,18-20,23-25,27H,8,11,15,17H2,1-7H3/b12-10+,26-16-/t23-,24+,25-,27+,30+,31-/m1/s1

Standard InChI Key:  YYRYDGANQRSQID-VJOROMODSA-N

Molfile:  

     RDKit          2D

 41 44  0  0  1  0  0  0  0  0999 V2000
    1.2042   -4.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8917   -4.6875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3958   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0875   -4.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1792   -3.9375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8667   -3.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3958   -3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6375   -1.6417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2042   -5.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1417   -3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3667   -4.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -4.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3167   -3.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3917   -3.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -3.0792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3042   -2.9417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9417   -2.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8167   -1.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8208   -3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6125   -2.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8208   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7250   -1.6750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1417   -2.2625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1042   -1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5167   -1.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4875   -6.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5042   -0.8750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3292   -5.3750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -5.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6125   -6.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2667   -2.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3667   -3.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1083   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3958   -5.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8208   -5.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1542   -5.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4042   -6.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4042   -7.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2000   -7.6625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4000   -2.6750    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4000   -5.1500    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  4  1  0
  4  1  2  0
  5  2  1  0
  6  5  1  0
  7  3  1  0
  8 18  1  0
  9  1  1  0
 10  6  1  0
 11  2  1  0
 12  3  1  0
 13  7  1  0
 14 11  2  0
 15  7  1  0
 16 20  1  0
 17  8  2  0
 18 24  1  0
 19 21  1  0
 20 18  2  0
 21 12  1  0
 22 23  1  0
 10 23  1  6
 24 25  2  0
 25 22  1  0
 26  9  2  0
 27 22  2  0
  2 28  1  1
 12 29  1  1
 30  9  1  0
  6 31  1  1
 32 16  1  0
 33 15  1  0
 34 29  1  0
 35 29  1  0
 36 28  1  0
 37 30  1  0
 38 37  1  0
 39 38  1  0
  7 40  1  1
  3 41  1  1
  6 14  1  0
 13 10  1  0
 15 19  2  0
 16 17  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA371830

   propyl (1R,2E,4S,5R,9R,11S,12S)-1-methoxy-8,12-dimethyl-11-[(E)-3-(1-methylimidazol-4-yl)prop-2-enoyl]oxy-5-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-2,7,13-triene-2-carboxylate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 538.69

Molecular Weight (Monoisotopic): 538.3043

AlogP: 5.17

#Rotatable Bonds: 8

Polar Surface Area: 88.88

Molecular Species: NEUTRAL

HBA: 8

HBD: ┄

#RO5 Violations: 2

HBA (Lipinski): 8

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: 5.70

CX LogP: 6.20

CX LogD: 6.19

Aromatic Rings: 1

Heavy Atoms: 39

QED Weighted: 0.26

Np Likeness Score: 2.04

References

1. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

2. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

Source

Source(1):

• Scientific Literature