3-fluoro-4-(1-(3-(isopropylamino)pyrazino[2,3-d]pyridazin-2-yl)piperidin-4-yloxy)benzonitrile 2,2,2-trifluoroacetic acid

ID: ALA3718345

PubChem CID: 127024253

Max Phase: Preclinical

Molecular Formula: C23H23F4N7O3

Molecular Weight: 407.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Nc1nc2cnncc2nc1N1CCC(Oc2ccc(C#N)cc2F)CC1.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C21H22FN7O.C2HF3O2/c1-13(2)26-20-21(28-18-12-25-24-11-17(18)27-20)29-7-5-15(6-8-29)30-19-4-3-14(10-23)9-16(19)22;3-2(4,5)1(6)7/h3-4,9,11-13,15H,5-8H2,1-2H3,(H,26,27);(H,6,7)

Standard InChI Key:  HCKQLTGISDMWHB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
    7.6928    0.3669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3928    1.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3928    2.3169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3534    0.5173    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7323    0.9666    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.7320   -0.2332    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.6928   -0.8331    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8096    3.7478    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9091   -1.5019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9086    1.5029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9097    3.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2093    3.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5078    3.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5067    1.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2071    0.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1077    2.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9067   -3.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1016    1.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3975    0.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6996    1.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7059    2.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4100    3.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.4150    4.9391    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9962    0.7279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.0330    0.1236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9447   -3.6050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8664   -3.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  1  0
  1  7  1  0
  9 10  2  0
 10 11  1  0
 11 14  2  0
 13 12  2  0
 12  9  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 10 19  1  0
  9 20  1  0
 20 21  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23  8  1  0
  8 26  1  0
 19 27  1  0
 26 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 26  1  0
 32 33  1  0
 30 34  1  0
 34 35  3  0
 27 36  1  0
 27 37  1  0
M  END

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 407.45Molecular Weight (Monoisotopic): 407.1870AlogP: 3.30#Rotatable Bonds: 5
Polar Surface Area: 99.85Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.30CX LogD: 2.30
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.69Np Likeness Score: -1.38

References

1.  (2014)  Quinoxaline derivatives as gpr6 modulators, 
2.  (2015)  Quinoxaline derivatives as gpr6 modulators, 

Source