The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(1-ethyl-1H-indazol-5-yl)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-2-propyl-4H,7H-pyrazolo[1,5-a]pyrimidin-7-one ID: ALA3718403
PubChem CID: 136242595
Max Phase: Preclinical
Molecular Formula: C21H21N7O2
Molecular Weight: 403.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1nn2c(=O)cc(-c3ccc4c(cnn4CC)c3)[nH]c2c1-c1nc(C)no1
Standard InChI: InChI=1S/C21H21N7O2/c1-4-6-15-19(21-23-12(3)26-30-21)20-24-16(10-18(29)28(20)25-15)13-7-8-17-14(9-13)11-22-27(17)5-2/h7-11,24H,4-6H2,1-3H3
Standard InChI Key: LZLRAPNSYSEVTN-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 -2.7132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8506 -1.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0505 -1.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6243 2.9682 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7308 4.4645 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3406 5.0280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3751 3.8801 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1749 2.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0517 6.1927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6395 3.4592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.5184 2.2403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.6468 1.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2234 1.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9312 0.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6117 2.9912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9221 3.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2188 2.9991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1069 4.8826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.2813 5.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
1 6 1 0
7 8 2 0
8 9 1 0
6 7 1 0
1 9 2 0
5 10 2 0
11 12 1 0
12 13 1 0
8 11 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
14 18 1 0
16 19 1 0
9 18 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
20 28 1 0
23 28 2 0
29 30 1 0
20 29 1 0
3 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 403.45Molecular Weight (Monoisotopic): 403.1757AlogP: 3.37#Rotatable Bonds: 5Polar Surface Area: 106.90Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.59CX Basic pKa: 1.15CX LogP: 2.82CX LogD: 2.82Aromatic Rings: 5Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -1.84
References 1. (2014) Heterocyclic compounds for the inhibition of pask, 2. (2015) Heterocyclic compounds for the inhibition of pask,