1-(2,4-dihydroxybenzoyl)-N,N-diethyl-2-methyl-1,2,3,4-tetrahydroquinoline-6-sulfonamide

ID: ALA3718685

PubChem CID: 117967756

Max Phase: Preclinical

Molecular Formula: C21H26N2O5S

Molecular Weight: 418.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)S(=O)(=O)c1ccc2c(c1)CCC(C)N2C(=O)c1ccc(O)cc1O

Standard InChI:  InChI=1S/C21H26N2O5S/c1-4-22(5-2)29(27,28)17-9-11-19-15(12-17)7-6-14(3)23(19)21(26)18-10-8-16(24)13-20(18)25/h8-14,24-25H,4-7H2,1-3H3

Standard InChI Key:  LLWJFRPCKCAMKV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   -4.9497    0.8990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9106    1.4992    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9500    2.0989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2037   -5.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9072   -5.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6056   -5.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -3.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8969   -2.9922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1985   -3.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5685   -5.8503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2450   -5.8341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2995   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2613   -3.5999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6321   -1.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9114    3.0001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2110    3.7506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2116    4.9506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6133    3.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6152    4.9534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  6 10  1  0
  4 11  1  0
  7 12  1  0
 12 20  1  0
 12 13  2  0
 18 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 19  1  0
 18 19  2  0
 18 23  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 21 24  1  0
 15  2  1  0
  2 25  1  0
 25 26  1  0
 26 27  1  0
 25 28  1  0
 28 29  1  0
M  END

Associated Targets(Human)

PDK2 Tchem Pyruvate dehydrogenase kinase (522 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 418.52Molecular Weight (Monoisotopic): 418.1562AlogP: 3.11#Rotatable Bonds: 5
Polar Surface Area: 98.15Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.83CX Basic pKa: CX LogP: 2.99CX LogD: 2.85
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.78Np Likeness Score: -1.21

References

1.  (2015)  Tetrahydroisoquinoline compounds and their use as pyruvate dehydrogenase kinase inhibitors, 
2. Morrell, J A JA and 5 more authors.  2003-12  AZD7545 is a selective inhibitor of pyruvate dehydrogenase kinase 2.  [PMID:14641019]
3. Moore, Jonathan D and 12 more authors.  2014-12-30  VER-246608, a novel pan-isoform ATP competitive inhibitor of pyruvate dehydrogenase kinase, disrupts Warburg metabolism and induces context-dependent cytostasis in cancer cells.  [PMID:25404640]
4. Tso, Shih-Chia and 9 more authors.  2017-02-09  Development of Dihydroxyphenyl Sulfonylisoindoline Derivatives as Liver-Targeting Pyruvate Dehydrogenase Kinase Inhibitors.  [PMID:28085286]

Source