N-cyclopropyl-3-(4-(4-fluorophenylsulfonyl)piperidin-1-yl)-7-methylpyrido[3,4-b]pyrazin-2-amine 2,2,2-trifluoroacetic acid

ID: ALA3718817

PubChem CID: 90038064

Max Phase: Preclinical

Molecular Formula: C24H25F4N5O4S

Molecular Weight: 441.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc2nc(NC3CC3)c(N3CCC(S(=O)(=O)c4ccc(F)cc4)CC3)nc2cn1.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C22H24FN5O2S.C2HF3O2/c1-14-12-19-20(13-24-14)27-22(21(26-19)25-16-4-5-16)28-10-8-18(9-11-28)31(29,30)17-6-2-15(23)3-7-17;3-2(4,5)1(6)7/h2-3,6-7,12-13,16,18H,4-5,8-11H2,1H3,(H,25,26);(H,6,7)

Standard InChI Key:  JDDBYQHDBDUDIE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    8.9926    2.3944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6926    3.1444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6926    4.3444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6531    2.5448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0320    2.9941    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.0317    1.7943    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.9926    1.1944    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8467    3.1494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8080    3.7505    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8070    2.5505    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9091   -1.5019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9086    1.5029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9097    3.0028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2093    3.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5078    3.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5067    1.5010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2071    0.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8101    5.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9067   -3.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1101    5.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1121    7.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8141    8.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5140    7.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5120    6.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8157    9.4513    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6522   -4.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1522   -4.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6321   -1.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  1  6  1  0
  1  7  1  0
  9  8  2  0
 10  9  2  0
 11 12  2  0
 12 13  1  0
 13 16  2  0
 15 14  2  0
 14 11  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 12 21  1  0
 11 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25  9  1  0
  9 28  1  0
 21 29  1  0
 28 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 28  1  0
 32 35  1  0
 36 29  1  0
 37 36  1  0
 29 37  1  0
 18 38  1  0
M  END

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.53Molecular Weight (Monoisotopic): 441.1635AlogP: 3.49#Rotatable Bonds: 5
Polar Surface Area: 88.08Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.63CX LogP: 2.55CX LogD: 2.55
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -1.59

References

1.  (2014)  Quinoxaline derivatives as gpr6 modulators, 
2.  (2015)  Quinoxaline derivatives as gpr6 modulators, 

Source