The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-Benzyl-N-{[5-(4-chlorophenyl)-1-benzothiophene-2-yl]carbonyl}tyrosine ID: ALA3718920
PubChem CID: 59335825
Max Phase: Preclinical
Molecular Formula: C31H24ClNO4S
Molecular Weight: 542.06
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)O)c1cc2cc(-c3ccc(Cl)cc3)ccc2s1
Standard InChI: InChI=1S/C31H24ClNO4S/c32-25-11-8-22(9-12-25)23-10-15-28-24(17-23)18-29(38-28)30(34)33-27(31(35)36)16-20-6-13-26(14-7-20)37-19-21-4-2-1-3-5-21/h1-15,17-18,27H,16,19H2,(H,33,34)(H,35,36)
Standard InChI Key: UCXBGBXPBKOZEO-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 -1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6203 -2.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9210 -3.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2184 -2.9893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2150 -1.4893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9143 -0.7422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2590 -3.5870 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7008 -0.9930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 1.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0916 0.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0552 2.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5559 2.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5072 -0.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2915 0.0970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2911 4.0047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7910 4.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5558 2.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8207 1.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3208 1.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0566 2.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8199 1.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3207 1.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0856 0.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5855 0.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3206 1.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5558 2.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0559 2.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
2 10 1 0
13 16 1 0
8 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
22 23 1 0
21 24 1 0
21 25 2 0
23 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 23 1 0
28 31 1 0
31 32 1 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.06Molecular Weight (Monoisotopic): 541.1115AlogP: 7.23#Rotatable Bonds: 9Polar Surface Area: 75.63Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.18CX Basic pKa: ┄CX LogP: 7.58CX LogD: 4.53Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.21Np Likeness Score: -0.92
References 1. (2010) Regulating agent of GPR34 receptor function,