The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-Benzyl-N-{[6-(2-phenethyl)imidazo[1,2-a]pyridin-2-yl]carbonyl}tyrosine ID: ALA3719062
PubChem CID: 59335832
Max Phase: Preclinical
Molecular Formula: C32H29N3O4
Molecular Weight: 519.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)O)c1cn2cc(CCc3ccccc3)ccc2n1
Standard InChI: InChI=1S/C32H29N3O4/c36-31(29-21-35-20-25(15-18-30(35)33-29)12-11-23-7-3-1-4-8-23)34-28(32(37)38)19-24-13-16-27(17-14-24)39-22-26-9-5-2-6-10-26/h1-10,13-18,20-21,28H,11-12,19,22H2,(H,34,36)(H,37,38)
Standard InChI Key: TWSXTSPPLQSRBN-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7008 -0.9930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 1.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0552 2.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0916 0.0795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2915 0.0970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5559 2.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2911 4.0047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7910 4.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5558 2.7315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8207 1.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3208 1.4068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0566 2.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8199 1.4534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3207 1.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0856 0.1771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5855 0.1942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3206 1.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5558 2.7921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0559 2.7750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5072 -0.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 -1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 -2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 -3.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9402 -5.2369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2443 -5.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5383 -5.2194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5281 -3.7194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2240 -2.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
8 10 1 0
10 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
15 16 2 0
14 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
20 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
15 31 1 0
2 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.60Molecular Weight (Monoisotopic): 519.2158AlogP: 5.12#Rotatable Bonds: 11Polar Surface Area: 92.93Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.96CX Basic pKa: 3.93CX LogP: 5.21CX LogD: 2.62Aromatic Rings: 5Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -0.79
References 1. (2010) Regulating agent of GPR34 receptor function,