(R)-2-(cyclopropylamino)-3-(4-((2,4-difluorophenyl)fluoromethyl)piperidin-1-yl)pyrido[3,4-b]pyrazine-7-carbonitrile

ID: ALA3719402

PubChem CID: 90039456

Max Phase: Preclinical

Molecular Formula: C23H21F3N6

Molecular Weight: 438.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1cc2nc(NC3CC3)c(N3CCC([C@@H](F)c4ccc(F)cc4F)CC3)nc2cn1

Standard InChI:  InChI=1S/C23H21F3N6/c24-14-1-4-17(18(25)9-14)21(26)13-5-7-32(8-6-13)23-22(29-15-2-3-15)30-19-10-16(11-27)28-12-20(19)31-23/h1,4,9-10,12-13,15,21H,2-3,5-8H2,(H,29,30)/t21-/m1/s1

Standard InChI Key:  OPCAETGRTOUXGY-OAQYLSRUSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -9.4683    1.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.4683    0.1004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1692   -0.6495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1692    2.3505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8702    1.6005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8702    0.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5712   -0.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2721    0.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2721    1.6005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5712    2.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7673   -0.6496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7673    2.3504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7673    3.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.0664    4.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.3654    3.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.3654    2.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.0664    1.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6644    4.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.9635    3.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.9635    2.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.2625    1.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.5615    2.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.5616    3.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.2625    4.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.8606    1.6004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -17.2625    6.1004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -14.6644    6.1004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7673   -2.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.5173   -3.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0173   -3.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9731   -0.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6740   -1.3995    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2 11  1  0
  1 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 22 25  1  0
 24 26  1  0
 18 27  1  6
 11 28  1  0
 29 28  1  0
 30 29  1  0
 28 30  1  0
  8 31  1  0
 31 32  3  0
M  END

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.46Molecular Weight (Monoisotopic): 438.1780AlogP: 4.68#Rotatable Bonds: 5
Polar Surface Area: 77.73Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.30CX LogD: 4.30
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: -1.50

References

1.  (2015)  Quinoxaline derivatives as gpr6 modulators, 

Source