The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-(cyclopropylamino)-3-(4-((2,4-difluorophenyl)fluoromethyl)piperidin-1-yl)pyrido[3,4-b]pyrazine-7-carbonitrile ID: ALA3719402
PubChem CID: 90039456
Max Phase: Preclinical
Molecular Formula: C23H21F3N6
Molecular Weight: 438.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1cc2nc(NC3CC3)c(N3CCC([C@@H](F)c4ccc(F)cc4F)CC3)nc2cn1
Standard InChI: InChI=1S/C23H21F3N6/c24-14-1-4-17(18(25)9-14)21(26)13-5-7-32(8-6-13)23-22(29-15-2-3-15)30-19-10-16(11-27)28-12-20(19)31-23/h1,4,9-10,12-13,15,21H,2-3,5-8H2,(H,29,30)/t21-/m1/s1
Standard InChI Key: OPCAETGRTOUXGY-OAQYLSRUSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-9.4683 1.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.4683 0.1004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1692 -0.6495 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.1692 2.3505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.8702 1.6005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8702 0.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5712 -0.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2721 0.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2721 1.6005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.5712 2.3505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.7673 -0.6496 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.7673 2.3504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.7673 3.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0664 4.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.3654 3.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.3654 2.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0664 1.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.6644 4.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.9635 3.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.9635 2.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.2625 1.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.5615 2.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.5616 3.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-17.2625 4.6004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.8606 1.6004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-17.2625 6.1004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-14.6644 6.1004 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-10.7673 -2.1496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.5173 -3.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.0173 -3.4486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9731 -0.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6740 -1.3995 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
1 12 1 0
12 13 1 0
12 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
24 26 1 0
18 27 1 6
11 28 1 0
29 28 1 0
30 29 1 0
28 30 1 0
8 31 1 0
31 32 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.46Molecular Weight (Monoisotopic): 438.1780AlogP: 4.68#Rotatable Bonds: 5Polar Surface Area: 77.73Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.30CX LogD: 4.30Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.62Np Likeness Score: -1.50
References 1. (2015) Quinoxaline derivatives as gpr6 modulators,