N-cyclopropyl-3-(4-(2-fluoro-4-methoxyphenoxy)piperidin-1-yl)pyridazino[4,5-b]pyrazin-2-amine

ID: ALA3719439

PubChem CID: 118308624

Max Phase: Preclinical

Molecular Formula: C21H23FN6O2

Molecular Weight: 410.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(OC2CCN(c3nc4cnncc4nc3NC3CC3)CC2)c(F)c1

Standard InChI:  InChI=1S/C21H23FN6O2/c1-29-15-4-5-19(16(22)10-15)30-14-6-8-28(9-7-14)21-20(25-13-2-3-13)26-17-11-23-24-12-18(17)27-21/h4-5,10-14H,2-3,6-9H2,1H3,(H,25,26)

Standard InChI Key:  CHGGFUGLNUBFDE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   -5.9461   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9462   -6.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6471   -7.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6471   -4.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3481   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3481   -6.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0490   -7.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -6.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -5.2500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0490   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2452   -7.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2452   -4.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2452   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5442   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8433   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8433   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.5442   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1423   -2.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -12.4413   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2452   -9.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9952  -10.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4952  -10.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.4413   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7404   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.0394   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.0394   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7404   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7404   -0.7500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -16.3384   -5.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -17.6375   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2 11  1  0
  1 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 11 20  1  0
 21 20  1  0
 22 21  1  0
 20 22  1  0
 19 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 19  1  0
 27 28  1  0
 25 29  1  0
 29 30  1  0
M  END

Alternative Forms

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 410.45Molecular Weight (Monoisotopic): 410.1867AlogP: 3.19#Rotatable Bonds: 6
Polar Surface Area: 85.29Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.97CX LogD: 1.97
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -1.15

References

1.  (2015)  Quinoxaline derivatives as gpr6 modulators, 

Source