3-(1-(2-(cyclopropylamino)pyrido[3,4-b]pyrazin-3-yl)piperidine-4-carbonyl)benzonitrile

ID: ALA3719475

PubChem CID: 90038923

Max Phase: Preclinical

Molecular Formula: C23H22N6O

Molecular Weight: 398.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N#Cc1cccc(C(=O)C2CCN(c3nc4cnccc4nc3NC3CC3)CC2)c1

Standard InChI:  InChI=1S/C23H22N6O/c24-13-15-2-1-3-17(12-15)21(30)16-7-10-29(11-8-16)23-22(26-18-4-5-18)27-19-6-9-25-14-20(19)28-23/h1-3,6,9,12,14,16,18H,4-5,7-8,10-11H2,(H,26,27)

Standard InChI Key:  GWOQHSURYUKLDM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
   -8.4739   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4739   -6.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1749   -7.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1748   -4.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8758   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8758   -6.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5768   -7.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2777   -6.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2777   -5.2500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5768   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7729   -7.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7729   -4.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7729   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.0720   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.3710   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.3710   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.0720   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.6700   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.9691   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.7729   -9.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.5229  -10.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0229  -10.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.6700   -0.7500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -16.2681   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.5672   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -17.5672   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.2681   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.9691   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.2681   -6.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.2681   -8.2500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  2 11  1  0
  1 12  1  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  0
 18 19  1  0
 11 20  1  0
 21 20  1  0
 22 21  1  0
 20 22  1  0
 18 23  2  0
 19 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 19  1  0
 27 29  1  0
 29 30  3  0
M  END

Alternative Forms

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.47Molecular Weight (Monoisotopic): 398.1855AlogP: 3.57#Rotatable Bonds: 5
Polar Surface Area: 94.80Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.98CX LogP: 3.00CX LogD: 3.00
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -1.61

References

1.  (2015)  Quinoxaline derivatives as gpr6 modulators, 

Source