The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-azetidin-1-yl(2-(cyclopropylamino)-3-(4-((2,4-difluorophenyl)fluoromethyl)piperidin-1-yl)pyrido[3,4-b]pyrazin-7-yl)methanone ID: ALA3719518
PubChem CID: 90039351
Max Phase: Preclinical
Molecular Formula: C26H27F3N6O
Molecular Weight: 496.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cc2nc(NC3CC3)c(N3CCC([C@H](F)c4ccc(F)cc4F)CC3)nc2cn1)N1CCC1
Standard InChI: InChI=1S/C26H27F3N6O/c27-16-2-5-18(19(28)12-16)23(29)15-6-10-34(11-7-15)25-24(31-17-3-4-17)32-20-13-21(30-14-22(20)33-25)26(36)35-8-1-9-35/h2,5,12-15,17,23H,1,3-4,6-11H2,(H,31,32)/t23-/m0/s1
Standard InChI Key: CHSNUCJVBNKKJL-QHCPKHFHSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
-15.5775 -2.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3813 -5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3813 -6.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0823 -7.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0823 -4.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.7833 -5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7833 -6.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4842 -7.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1852 -6.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1852 -5.2500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4842 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6804 -7.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.6804 -4.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.6804 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9794 -2.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2785 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2785 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9794 -5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.8765 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6804 -9.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.4304 -10.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9304 -10.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.8765 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.1756 -5.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.4746 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-19.4746 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-18.1756 -2.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5775 -0.7500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-18.1756 -0.7500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-20.7736 -5.2500 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8861 -7.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8861 -9.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5871 -6.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1382 -7.1383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -5.6894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1989 -5.3011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
3 12 1 0
2 13 1 0
13 14 1 0
13 18 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
16 1 1 0
1 19 1 0
12 20 1 0
21 20 1 0
22 21 1 0
20 22 1 0
19 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 19 1 0
1 28 1 1
27 29 1 0
25 30 1 0
9 31 1 0
31 32 2 0
31 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.54Molecular Weight (Monoisotopic): 496.2198AlogP: 4.65#Rotatable Bonds: 6Polar Surface Area: 74.25Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.52CX LogP: 3.63CX LogD: 3.63Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.54Np Likeness Score: -1.55
References 1. (2015) Quinoxaline derivatives as gpr6 modulators,