(S)-azetidin-1-yl(2-(cyclopropylamino)-3-(4-((2,4-difluorophenyl)fluoromethyl)piperidin-1-yl)pyrido[3,4-b]pyrazin-7-yl)methanone

ID: ALA3719518

PubChem CID: 90039351

Max Phase: Preclinical

Molecular Formula: C26H27F3N6O

Molecular Weight: 496.54

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1cc2nc(NC3CC3)c(N3CCC([C@H](F)c4ccc(F)cc4F)CC3)nc2cn1)N1CCC1

Standard InChI:  InChI=1S/C26H27F3N6O/c27-16-2-5-18(19(28)12-16)23(29)15-6-10-34(11-7-15)25-24(31-17-3-4-17)32-20-13-21(30-14-22(20)33-25)26(36)35-8-1-9-35/h2,5,12-15,17,23H,1,3-4,6-11H2,(H,31,32)/t23-/m0/s1

Standard InChI Key:  CHSNUCJVBNKKJL-QHCPKHFHSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
  -15.5775   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3813   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3813   -6.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0823   -7.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0823   -4.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7833   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7833   -6.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4842   -7.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1852   -6.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1852   -5.2500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4842   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6804   -7.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6804   -4.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6804   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9794   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2785   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.2785   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9794   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.8765   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6804   -9.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.4304  -10.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.9304  -10.2991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -16.8765   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1756   -5.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.4746   -4.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -19.4746   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1756   -2.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5775   -0.7500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -18.1756   -0.7500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  -20.7736   -5.2500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8861   -7.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8861   -9.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5871   -6.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1382   -7.1383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -5.6894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1989   -5.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  3 12  1  0
  2 13  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16  1  1  0
  1 19  1  0
 12 20  1  0
 21 20  1  0
 22 21  1  0
 20 22  1  0
 19 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 19  1  0
  1 28  1  1
 27 29  1  0
 25 30  1  0
  9 31  1  0
 31 32  2  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 33  1  0
M  END

Associated Targets(Human)

GPR6 Tchem G-protein coupled receptor 6 (1468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.54Molecular Weight (Monoisotopic): 496.2198AlogP: 4.65#Rotatable Bonds: 6
Polar Surface Area: 74.25Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 0.52CX LogP: 3.63CX LogD: 3.63
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.54Np Likeness Score: -1.55

References

1.  (2015)  Quinoxaline derivatives as gpr6 modulators, 

Source