(S)-3-(2-Methyl-thiazol-4-yl)-acrylic acid (4R,5S,14S,15R)-11-(3-acetoxy-4,5-dihydroxy-tetrahydro-pyran-2-yloxymethyl)-8-isopropyl-12-methoxy-1-methyl-5-(R)-methyl-15-oxa-tricyclo[10.2.1.0*4,9*]pentadeca-5,10,13-trien-2-yl ester

ID: ALA372167

PubChem CID: 44403725

Max Phase: Preclinical

Molecular Formula: C35H47NO10S

Molecular Weight: 673.83

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CO[C@]12C=C[C@](C)(O1)[C@@H](OC(=O)/C=C/c1csc(C)n1)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1/C=C\2COC1OCC(O)C(O)C1OC(C)=O

Standard InChI:  InChI=1S/C35H47NO10S/c1-19(2)25-10-8-20(3)26-15-29(45-30(39)11-9-24-18-47-21(4)36-24)34(6)12-13-35(41-7,46-34)23(14-27(25)26)16-42-33-32(44-22(5)37)31(40)28(38)17-43-33/h8-9,11-14,18-19,25-29,31-33,38,40H,10,15-17H2,1-7H3/b11-9+,23-14-/t25-,26+,27-,28?,29+,31?,32?,33?,34+,35-/m1/s1

Standard InChI Key:  SYJCEQUPYWPIST-JLQYLIJZSA-N

Molfile:  

     RDKit          2D

 49 53  0  0  1  0  0  0  0  0999 V2000
    5.0500   -1.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3625   -1.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7625   -1.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4292   -4.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2417   -1.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3375   -0.9750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0250   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7625   -0.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6500   -4.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7667    0.4583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3000   -0.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7667   -4.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0500   -1.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4792   -0.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5250   -1.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5500   -0.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0500   -0.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4667    0.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1042    0.5458    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.9750    1.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0292   -5.2417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3792   -3.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3375   -0.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3375   -1.3625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8792    1.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9792   -5.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3000    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7917    1.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2625    1.6708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6792    1.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3625   -2.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0750   -3.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7667   -3.4500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3417   -4.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6667    2.0875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8167   -3.8292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4875   -2.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4542   -4.6292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0500   -2.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8042   -6.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250    0.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0500    0.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4625   -0.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0875   -2.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7667   -3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3375   -3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3125   -2.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7542    0.2875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7542   -2.1875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4 12  1  0
  5  2  2  0
  6  1  1  0
  7  6  1  0
  8  3  1  0
  9  4  1  0
 10 20  1  0
 11  7  1  0
 12 33  1  0
 13  3  1  0
 14 11  1  0
 15  1  1  0
 16 15  2  0
 17  8  1  0
 18 10  2  0
 19 28  1  0
 20 29  1  0
 21 12  1  0
 22  4  1  0
 23 24  1  0
 24 13  1  0
 25 27  1  0
 26 34  1  0
 11 27  1  6
 28 20  2  0
 29 30  2  0
 30 25  1  0
 31  2  1  0
 32 22  1  0
 33 31  1  0
 34 21  1  0
 35 25  2  0
 36 32  2  0
  1 37  1  1
 38  9  1  0
 13 39  1  1
 40 26  1  0
  7 41  1  1
 42 17  1  0
 43 18  1  0
 44 32  1  0
 45 39  1  0
 46 39  1  0
 47 37  1  0
  8 48  1  1
  3 49  1  1
 16  7  1  0
 14  8  1  0
 17 23  2  0
  9 26  1  0
 19 18  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA372167

   [(1S,2S,4R,8R,9S,10Z,12R)-11-[(3-acetyloxy-4,5-dihydroxyoxan-2-yl)oxymethyl]-12-methoxy-1,5-dimethyl-8-propan-2-yl-15-oxatricyclo[10.2.1.04,9]pentadeca-5,10,13-trien-2-yl] (E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 673.83

Molecular Weight (Monoisotopic): 673.2921

AlogP: 4.28

#Rotatable Bonds: 9

Polar Surface Area: 142.87

Molecular Species: NEUTRAL

HBA: 12

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 11

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 12.81

CX Basic pKa: 2.71

CX LogP: 4.45

CX LogD: 4.45

Aromatic Rings: 1

Heavy Atoms: 47

QED Weighted: 0.22

Np Likeness Score: 2.26

References

1. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

2. Nicolaou KC..  (2005)  Joys of molecules. 2. Endeavors in chemical biology and medicinal chemistry.,  48  (18): [PMID:16134928] [10.1021/jm050524f]

Source

Source(1):

• Scientific Literature