3-{[(7-Methoxy-3-methyl-1-benzothien-2-yl)sulfonyl]amino}benzoic acid

ID: ALA3727631

PubChem CID: 56941308

Max Phase: Preclinical

Molecular Formula: C17H15NO5S2

Molecular Weight: 377.44

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc2c(C)c(S(=O)(=O)Nc3cccc(C(=O)O)c3)sc12

Standard InChI:  InChI=1S/C17H15NO5S2/c1-10-13-7-4-8-14(23-2)15(13)24-17(10)25(21,22)18-12-6-3-5-11(9-12)16(19)20/h3-9,18H,1-2H3,(H,19,20)

Standard InChI Key:  DZUYGSSDBJXOIB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133   -1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5871   -1.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3114   -2.9665    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5523   -4.4208    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9520   -5.4598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1518   -5.4603    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0532   -4.4218    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8036   -5.7215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3036   -5.7247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0509   -7.0252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2983   -8.3228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7983   -8.3197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0509   -7.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0425   -9.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8426   -9.6122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6386  -10.6579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
 10 11  1  0
 11 12  1  0
 12  3  1  0
 12  7  2  0
 10 13  1  0
 13 14  2  0
 13 15  2  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 23 24  2  0
 23 25  1  0
M  END

Associated Targets(Human)

PFKFB4 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 4 (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.44Molecular Weight (Monoisotopic): 377.0392AlogP: 3.72#Rotatable Bonds: 5
Polar Surface Area: 92.70Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.96CX Basic pKa: CX LogP: 3.52CX LogD: -0.32
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.71Np Likeness Score: -0.96

References

1.  (2012)  New compounds, 
2.  (2016)  Sulfonamide compounds,