The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-N-(3-(diethylamino)propyl)-2,4-dimethyl-5-((2-oxo-5-(1-phenyl-1H-pyrazol-4-yl)indolin-3-ylidene)methyl)-1H-pyrrole-3-carboxamide ID: ALA3727926
PubChem CID: 117622390
Max Phase: Preclinical
Molecular Formula: C32H36N6O2
Molecular Weight: 536.68
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(-c4cnn(-c5ccccc5)c4)cc32)c1C
Standard InChI: InChI=1S/C32H36N6O2/c1-5-37(6-2)16-10-15-33-32(40)30-21(3)29(35-22(30)4)18-27-26-17-23(13-14-28(26)36-31(27)39)24-19-34-38(20-24)25-11-8-7-9-12-25/h7-9,11-14,17-20,35H,5-6,10,15-16H2,1-4H3,(H,33,40)(H,36,39)/b27-18-
Standard InChI Key: NRMVNOHALPEPOV-IMRQLAEWSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 0.0269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7388 1.9224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0412 2.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7359 4.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2449 4.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1353 2.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6433 5.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7411 5.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9142 4.9935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2817 6.6750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2886 7.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8291 9.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7580 2.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2259 3.2843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.9730 1.9836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9669 0.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8393 4.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0560 5.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7704 7.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2699 7.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0549 6.0091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3406 4.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8361 10.3296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3766 11.7583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3835 12.8712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9101 12.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5440 13.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0162 14.0136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 2 0
14 17 1 0
16 18 1 0
15 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
24 25 2 0
25 26 1 0
26 27 1 0
27 28 2 0
28 24 1 0
1 24 1 0
26 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
23 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
38 39 1 0
37 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.68Molecular Weight (Monoisotopic): 536.2900AlogP: 5.44#Rotatable Bonds: 10Polar Surface Area: 95.05Molecular Species: BASEHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.19CX Basic pKa: 9.82CX LogP: 4.34CX LogD: 2.17Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.19Np Likeness Score: -1.30
References 1. (2014) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 2. (2019) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer,