The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-Methoxyphenyl)-N-[3-(1H-tetrazol-5-yl)phenyl]thiophene-2-sulfonamide ID: ALA3728006
PubChem CID: 56940872
Max Phase: Preclinical
Molecular Formula: C18H15N5O3S2
Molecular Weight: 413.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1-c1ccc(S(=O)(=O)Nc2cccc(-c3nnn[nH]3)c2)s1
Standard InChI: InChI=1S/C18H15N5O3S2/c1-26-15-8-3-2-7-14(15)16-9-10-17(27-16)28(24,25)21-13-6-4-5-12(11-13)18-19-22-23-20-18/h2-11,21H,1H3,(H,19,20,22,23)
Standard InChI Key: PXNKGZAABVGNTA-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2122 -3.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7464 -5.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7536 -5.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2149 -3.8587 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.6362 -6.4967 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.8294 -6.3690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3436 -7.4661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0288 -7.8691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9129 -9.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3078 -10.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1939 -11.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6851 -11.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2903 -10.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4042 -8.9198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7822 -9.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7700 -11.0797 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1371 -10.4624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9726 -8.9715 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5037 -8.6673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 3 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 9 1 0
12 14 1 0
14 15 2 0
14 16 2 0
14 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.48Molecular Weight (Monoisotopic): 413.0616AlogP: 3.40#Rotatable Bonds: 6Polar Surface Area: 109.86Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.28CX Basic pKa: ┄CX LogP: 3.17CX LogD: 0.80Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.50Np Likeness Score: -2.02
References 1. (2012) New compounds, 2. (2016) Sulfonamide compounds,