5-(2-Chlorophenyl)-N-[3-(1H-tetrazol-5-yl)phenyl]thiophene-2-sulfonamide

ID: ALA3728043

PubChem CID: 56940874

Max Phase: Preclinical

Molecular Formula: C17H12ClN5O2S2

Molecular Weight: 417.90

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(Nc1cccc(-c2nnn[nH]2)c1)c1ccc(-c2ccccc2Cl)s1

Standard InChI:  InChI=1S/C17H12ClN5O2S2/c18-14-7-2-1-6-13(14)15-8-9-16(26-15)27(24,25)21-12-5-3-4-11(10-12)17-19-22-23-20-17/h1-10,21H,(H,19,20,22,23)

Standard InChI Key:  NYGSNBPWVRTPQO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2122   -3.8625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7464   -5.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7536   -5.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2149   -3.8587    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6362   -6.4967    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.8294   -6.3690    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3436   -7.4661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0288   -7.8691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9129   -9.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3078  -10.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1939  -11.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6851  -11.5026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2903  -10.1301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4042   -8.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7822   -9.9678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7700  -11.0797    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1371  -10.4624    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9726   -8.9715    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5037   -8.6673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  2  0
 13 15  2  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
M  END

Associated Targets(Human)

PFKFB4 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 4 (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.90Molecular Weight (Monoisotopic): 417.0121AlogP: 4.05#Rotatable Bonds: 5
Polar Surface Area: 100.63Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.28CX Basic pKa: CX LogP: 3.94CX LogD: 1.57
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.51Np Likeness Score: -2.37

References

1.  (2012)  New compounds, 
2.  (2016)  Sulfonamide compounds,