The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-N-ethyl-2,4-dimethyl-5-((2-oxo-5-(2-phenylthiazol-4-yl)indolin-3-ylidene)methyl)-1H-pyrrole-3-carboxamide ID: ALA3728044
PubChem CID: 117622318
Max Phase: Preclinical
Molecular Formula: C27H24N4O2S
Molecular Weight: 468.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(-c4csc(-c5ccccc5)n4)cc32)c1C
Standard InChI: InChI=1S/C27H24N4O2S/c1-4-28-26(33)24-15(2)22(29-16(24)3)13-20-19-12-18(10-11-21(19)30-25(20)32)23-14-34-27(31-23)17-8-6-5-7-9-17/h5-14,29H,4H2,1-3H3,(H,28,33)(H,30,32)/b20-13-
Standard InChI Key: RUIFFZUDBNULIZ-MOSHPQCFSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7388 1.9224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0412 2.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7359 4.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2449 4.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1353 2.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6433 5.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 0.0269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7411 5.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2817 6.6750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9142 4.9935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2886 7.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9212 8.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7580 2.9756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2259 3.2843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9730 1.9836 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9669 0.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8393 4.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0560 5.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7704 7.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2699 7.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0549 6.0091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3406 4.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 2 0
13 16 1 0
15 17 1 0
8 18 2 0
14 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
22 23 1 0
1 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 24 2 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.58Molecular Weight (Monoisotopic): 468.1620AlogP: 5.66#Rotatable Bonds: 5Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.09CX Basic pKa: 1.59CX LogP: 5.13CX LogD: 5.13Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -1.16
References 1. (2014) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 2. (2019) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer,