The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-((1S,5R)-6-(6-(6-amino-5-(difluoromethoxy)pyridin-3-yl)-2-ethylpyrimidin-4-yl)-3-azabicyclo[3.1.0]hexan-3-yl)propan-2-ol ID: ALA3728116
PubChem CID: 117688780
Max Phase: Preclinical
Molecular Formula: C20H25F2N5O2
Molecular Weight: 405.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCc1nc(-c2cnc(N)c(OC(F)F)c2)cc([C@H]2[C@@H]3CN(CC(C)O)C[C@@H]32)n1
Standard InChI: InChI=1S/C20H25F2N5O2/c1-3-17-25-14(11-4-16(29-20(21)22)19(23)24-6-11)5-15(26-17)18-12-8-27(7-10(2)28)9-13(12)18/h4-6,10,12-13,18,20,28H,3,7-9H2,1-2H3,(H2,23,24)/t10?,12-,13+,18+
Standard InChI Key: VDFSZXGVPFLXPY-HHTXZJQKSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9395 -1.3434 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 0.4545 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.6051 5.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6425 5.3913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5939 6.0054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6035 7.3577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7865 5.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9746 6.0420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9673 7.4004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7917 8.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2570 8.1707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2356 9.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2658 10.2867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1878 10.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7741 6.3440 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4697 6.8579 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 8 1 0
5 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
12 18 1 0
18 19 1 0
22 20 1 0
20 21 1 0
20 10 1 6
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 21 1 0
24 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
22 30 1 6
21 31 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.45Molecular Weight (Monoisotopic): 405.1976AlogP: 2.31#Rotatable Bonds: 7Polar Surface Area: 97.39Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.99CX LogP: 2.26CX LogD: 0.67Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.73Np Likeness Score: -0.91
References 1. (2014) Biheteroaryl compounds and uses thereof, 2. (2014) Biheteroaryl compounds and uses thereof,