The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-N-(2-(diethylamino)ethyl)-2,4-dimethyl-5-((2-oxo-5-(1-(4-sulfamoylphenyl)-1H-pyrazol-4-yl)indolin-3-ylidene)methyl)-1H-pyrrole-3-carboxamide ID: ALA3728260
PubChem CID: 117622469
Max Phase: Preclinical
Molecular Formula: C31H35N7O4S
Molecular Weight: 601.73
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCNC(=O)c1c(C)[nH]c(/C=C2\C(=O)Nc3ccc(-c4cnn(-c5ccc(S(N)(=O)=O)cc5)c4)cc32)c1C
Standard InChI: InChI=1S/C31H35N7O4S/c1-5-37(6-2)14-13-33-31(40)29-19(3)28(35-20(29)4)16-26-25-15-21(7-12-27(25)36-30(26)39)22-17-34-38(18-22)23-8-10-24(11-9-23)43(32,41)42/h7-12,15-18,35H,5-6,13-14H2,1-4H3,(H,33,40)(H,36,39)(H2,32,41,42)/b26-16-
Standard InChI Key: OWMANXXDVOBLCG-QQXSKIMKSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
-7.3572 9.6298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.9846 8.6069 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-9.1842 8.6392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7889 0.0269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7388 1.9224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0412 2.6666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7359 4.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2449 4.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1353 2.1736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6433 5.3370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7411 5.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9142 4.9935 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2817 6.6750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2886 7.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8291 9.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8361 10.3296 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3766 11.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3039 10.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1080 10.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1817 12.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7580 2.9756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2259 3.2843 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.9730 1.9836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9669 0.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8393 4.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0560 5.9274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7704 7.2464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2699 7.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0549 6.0091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3406 4.6901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.5566 9.6618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 8 1 0
11 13 2 0
12 14 2 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 2 0
17 20 1 0
19 21 1 0
18 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
29 30 1 0
28 31 1 0
32 33 2 0
33 34 1 0
34 35 1 0
35 36 2 0
36 32 1 0
4 32 1 0
34 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 37 1 0
40 2 1 0
2 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 601.73Molecular Weight (Monoisotopic): 601.2471AlogP: 3.70#Rotatable Bonds: 10Polar Surface Area: 155.21Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.53CX Basic pKa: 9.03CX LogP: 2.97CX LogD: 1.48Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.20Np Likeness Score: -1.49
References 1. (2014) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 2. (2019) 3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer,