2,6-Dichloro-N-[3-(1H-tetrazol-5-yl)phenyl]-4-(trifluoromethyl)benzenesulfonamide

ID: ALA3728448

PubChem CID: 56943090

Max Phase: Preclinical

Molecular Formula: C14H8Cl2F3N5O2S

Molecular Weight: 438.22

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(Nc1cccc(-c2nnn[nH]2)c1)c1c(Cl)cc(C(F)(F)F)cc1Cl

Standard InChI:  InChI=1S/C14H8Cl2F3N5O2S/c15-10-5-8(14(17,18)19)6-11(16)12(10)27(25,26)22-9-3-1-2-7(4-9)13-20-23-24-21-13/h1-6,22H,(H,20,21,23,24)

Standard InChI Key:  FWWHLAWZTCOXKV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
    3.6384   -0.9011    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5988   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5984   -2.7004    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.6377   -2.1009    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5988    1.5004    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6378    0.9001    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6383    2.0999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5998    3.0012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8995    3.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9027    5.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2032    5.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5007    5.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4977    3.7464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1971    2.9990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7958    2.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1495    3.6095    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1491    2.4911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3944    1.1948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9283    1.5120    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  1  0
  2  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  7  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 12  5  1  0
  9 13  1  0
 13 14  2  0
 13 15  2  0
 13 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  1  0
M  END

Associated Targets(Human)

PFKFB4 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 4 (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 438.22Molecular Weight (Monoisotopic): 436.9728AlogP: 3.99#Rotatable Bonds: 4
Polar Surface Area: 100.63Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.28CX Basic pKa: CX LogP: 3.83CX LogD: 1.57
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.64Np Likeness Score: -2.23

References

1.  (2012)  New compounds, 
2.  (2016)  Sulfonamide compounds,