(Z)-2,4-dimethyl-5-((2-oxo-5-(1-phenyl-1H-pyrazol-4-yl)indolin-3-ylidene)methyl)-N-(1-(piperidin-1-ylmethyl)cyclopropyl)-1H-pyrrole-3-carboxamide

ID: ALA3728581

PubChem CID: 117622399

Max Phase: Preclinical

Molecular Formula: C34H36N6O2

Molecular Weight: 560.70

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1[nH]c(/C=C2\C(=O)Nc3ccc(-c4cnn(-c5ccccc5)c4)cc32)c(C)c1C(=O)NC1(CN2CCCCC2)CC1

Standard InChI:  InChI=1S/C34H36N6O2/c1-22-30(36-23(2)31(22)33(42)38-34(13-14-34)21-39-15-7-4-8-16-39)18-28-27-17-24(11-12-29(27)37-32(28)41)25-19-35-40(20-25)26-9-5-3-6-10-26/h3,5-6,9-12,17-20,36H,4,7-8,13-16,21H2,1-2H3,(H,37,41)(H,38,42)/b28-18-

Standard InChI Key:  SLABCXCVYCKPSQ-VEILYXNESA-N

Molfile:  

     RDKit          2D

 42 48  0  0  0  0  0  0  0  0999 V2000
    9.5850    7.3683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2234    6.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1555    6.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7889    0.0269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    2.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500    2.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2449    4.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7359    4.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0412    2.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7388    1.9224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168    1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7580    2.9756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2259    3.2843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9730    1.9836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9669    0.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8393    4.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0560    5.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7704    7.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2699    7.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0549    6.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3406    4.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6433    5.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1353    2.1736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7457    5.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3820    6.3856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2119    4.9213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6899    5.7087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1457    4.2788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6105    3.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0631    2.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0509    1.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5861    1.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1335    3.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  8  1  0
 11 13  2  0
 12 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 20  1  0
  4 20  1  0
 22 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 16 31  1  0
 18 32  1  0
 17 33  1  0
 33 34  2  0
 33 35  1  0
  2 35  1  0
  2 36  1  0
 36 37  1  0
 37 38  1  0
 37 42  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
M  END

Associated Targets(Human)

RIOK2 Tbio Serine/threonine-protein kinase RIO2 (621 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 560.70Molecular Weight (Monoisotopic): 560.2900AlogP: 5.73#Rotatable Bonds: 7
Polar Surface Area: 95.05Molecular Species: BASEHBA: 5HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.18CX Basic pKa: 8.73CX LogP: 5.04CX LogD: 3.70
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.25Np Likeness Score: -0.93

References

1.  (2014)  3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 
2.  (2019)  3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 

Source