The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,5-Dimemethoxyphenyl)-2-[5-(4-ethoxyphenyl)-4H-[1,2,4]triazol-3-ylsulfanyl]acetamide ID: ALA3728842
PubChem CID: 54575592
Max Phase: Preclinical
Molecular Formula: C20H22N4O4S
Molecular Weight: 414.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(-c2nnc(SCC(=O)Nc3cc(OC)cc(OC)c3)[nH]2)cc1
Standard InChI: InChI=1S/C20H22N4O4S/c1-4-28-15-7-5-13(6-8-15)19-22-20(24-23-19)29-12-18(25)21-14-9-16(26-2)11-17(10-14)27-3/h5-11H,4,12H2,1-3H3,(H,21,25)(H,22,23,24)
Standard InChI Key: BFHDCJINGRBYBF-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9511 -0.8815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9530 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2010 -3.2957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7343 -2.9815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4437 -1.8467 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.3221 -3.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8153 -2.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6938 -4.1290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.1869 -3.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0667 -5.1925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.5588 -5.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.1711 -3.6689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.2914 -2.4539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7994 -2.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.3071 -1.8175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6331 3.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.9013 -1.0826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-13.1961 -0.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.4415 -6.2520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-15.6349 -6.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 7 2 0
9 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
14 22 2 0
2 23 1 0
23 24 1 0
24 25 1 0
20 26 1 0
26 27 1 0
18 28 1 0
28 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 414.49Molecular Weight (Monoisotopic): 414.1362AlogP: 3.62#Rotatable Bonds: 9Polar Surface Area: 98.36Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.37CX Basic pKa: 1.73CX LogP: 2.72CX LogD: 2.68Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.52Np Likeness Score: -1.79
References 1. (2011) Small-molecule choline kinase inhibitors as anti-cancer therapeutics,