N-(3,5-Dimemethoxyphenyl)-2-[5-(4-ethoxyphenyl)-4H-[1,2,4]triazol-3-ylsulfanyl]acetamide

ID: ALA3728842

PubChem CID: 54575592

Max Phase: Preclinical

Molecular Formula: C20H22N4O4S

Molecular Weight: 414.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1ccc(-c2nnc(SCC(=O)Nc3cc(OC)cc(OC)c3)[nH]2)cc1

Standard InChI:  InChI=1S/C20H22N4O4S/c1-4-28-15-7-5-13(6-8-15)19-22-20(24-23-19)29-12-18(25)21-14-9-16(26-2)11-17(10-14)27-3/h5-11H,4,12H2,1-3H3,(H,21,25)(H,22,23,24)

Standard InChI Key:  BFHDCJINGRBYBF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9511   -0.8815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9530   -1.9978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2010   -3.2957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7343   -2.9815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4437   -1.8467    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3221   -3.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8153   -2.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.6938   -4.1290    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1869   -3.9776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.0667   -5.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.5588   -5.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.1711   -3.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2914   -2.4539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7994   -2.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3071   -1.8175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5972    1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6331    3.6061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.9013   -1.0826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -13.1961   -0.1116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.4415   -6.2520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -15.6349   -6.1268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11  7  2  0
  9 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 14 22  2  0
  2 23  1  0
 23 24  1  0
 24 25  1  0
 20 26  1  0
 26 27  1  0
 18 28  1  0
 28 29  1  0
M  END

Associated Targets(Human)

CHKA Tchem Choline kinase alpha (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 414.49Molecular Weight (Monoisotopic): 414.1362AlogP: 3.62#Rotatable Bonds: 9
Polar Surface Area: 98.36Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.37CX Basic pKa: 1.73CX LogP: 2.72CX LogD: 2.68
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.52Np Likeness Score: -1.79

References

1.  (2011)  Small-molecule choline kinase inhibitors as anti-cancer therapeutics, 

Source