The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(Dimethylamino)propyl 3-{[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonyl]amino}benzoate ID: ALA3728905
PubChem CID: 66799724
Max Phase: Preclinical
Molecular Formula: C21H23ClN2O4S2
Molecular Weight: 467.01
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(S(=O)(=O)Nc2cccc(C(=O)OCCCN(C)C)c2)sc2ccc(Cl)cc12
Standard InChI: InChI=1S/C21H23ClN2O4S2/c1-14-18-13-16(22)8-9-19(18)29-21(14)30(26,27)23-17-7-4-6-15(12-17)20(25)28-11-5-10-24(2)3/h4,6-9,12-13,23H,5,10-11H2,1-3H3
Standard InChI Key: UDDCJGZBQVGGJD-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
4.6987 -0.9974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0351 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2871 0.0482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8236 1.3429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3243 1.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0622 2.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5622 2.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3243 1.3880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5865 0.0820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0865 0.0680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3463 -1.2123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0907 -2.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 -1.3452 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.6063 -2.5179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5463 -1.2031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3661 -3.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6260 -5.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3859 -6.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6458 -7.7177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2534 -8.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4459 -7.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 2 1 0
2 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
4 12 1 0
12 16 1 0
15 13 1 0
13 4 2 0
10 14 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
13 21 1 0
19 22 1 0
14 23 1 0
14 24 2 0
23 25 1 0
26 25 1 0
26 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.01Molecular Weight (Monoisotopic): 466.0788AlogP: 4.77#Rotatable Bonds: 8Polar Surface Area: 75.71Molecular Species: ZWITTERIONHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.25CX Basic pKa: 9.46CX LogP: 3.38CX LogD: 3.34Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: -1.52