2-(5-(3-(methylsulfonyl)phenyl)thieno[2,3-d]pyrimidin-4-yl)-[1,2,4]triazolo[4,3-a]pyridine-3(2H)-thione

ID: ALA3729001

PubChem CID: 88576717

Max Phase: Preclinical

Molecular Formula: C19H13N5O2S3

Molecular Weight: 439.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)c1cccc(-c2csc3ncnc(-n4nc5ccccn5c4=S)c23)c1

Standard InChI:  InChI=1S/C19H13N5O2S3/c1-29(25,26)13-6-4-5-12(9-13)14-10-28-18-16(14)17(20-11-21-18)24-19(27)23-8-3-2-7-15(23)22-24/h2-11H,1H3

Standard InChI Key:  RFVNSHADNWTOPC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    6.2787    4.0879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4131    4.9190    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.7005    6.0841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1749    2.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6116    3.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9713    4.5022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8901    5.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4491    5.1252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0894    3.6690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9982    3.0140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5658    5.2528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2057    3.8444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2004    3.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7165    5.3049    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2217    5.2752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5696    6.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1700    7.8819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6647    7.9116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4563    6.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3451    3.5319    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 12 13  1  0
  7 19  1  0
 15  2  1  0
  2 20  1  0
 19 21  1  0
 21 24  2  0
 23 22  1  0
 22 19  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 22 29  2  0
M  END

Associated Targets(Human)

PIP4K2C Tchem Phosphatidylinositol-5-phosphate 4-kinase type-2 gamma (641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 439.55Molecular Weight (Monoisotopic): 439.0231AlogP: 3.93#Rotatable Bonds: 3
Polar Surface Area: 82.15Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.66CX LogD: 3.66
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.40Np Likeness Score: -2.39

References

1.  (2012)  Compounds, pharmaceutical compositions, and methods of treating or preventing neurodegenerative diseases or disorders, 
2. Klaeger, Susan S and 47 more authors.  2017-12-01  The target landscape of clinical kinase drugs.  [PMID:29191878]

Source