(S,Z)-2,4-dimethyl-5-((2-oxo-5-(1-phenyl-1H-pyrazol-4-yl)indolin-3-ylidene)methyl)-N-(pyrrolidin-2-ylmethyl)-1H-pyrrole-3-carboxamide dihydrochloride

ID: ALA3729089

PubChem CID: 127034682

Max Phase: Preclinical

Molecular Formula: C30H32Cl2N6O2

Molecular Weight: 506.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1[nH]c(/C=C2\C(=O)Nc3ccc(-c4cnn(-c5ccccc5)c4)cc32)c(C)c1C(=O)NC[C@@H]1CCCN1.Cl.Cl

Standard InChI:  InChI=1S/C30H30N6O2.2ClH/c1-18-27(34-19(2)28(18)30(38)32-16-22-7-6-12-31-22)14-25-24-13-20(10-11-26(24)35-29(25)37)21-15-33-36(17-21)23-8-4-3-5-9-23;;/h3-5,8-11,13-15,17,22,31,34H,6-7,12,16H2,1-2H3,(H,32,38)(H,35,37);2*1H/b25-14-;;/t22-;;/m0../s1

Standard InChI Key:  CXJMFRKOCDLMRJ-IYSVZGAQSA-N

Molfile:  

     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   15.5839    2.8870    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7889    0.0269    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    2.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500    2.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2449    4.2986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7359    4.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0412    2.6666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7388    1.9224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168    1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7580    2.9756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2259    3.2843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9730    1.9836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9669    0.8711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8393    4.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0560    5.9274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7704    7.2464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2699    7.2872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0549    6.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3406    4.6901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6433    5.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1353    2.1736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7457    5.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3820    6.3856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2119    4.9213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2234    6.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6896    5.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7909    6.7087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0839    5.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7604    4.4837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2674    4.3388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0839    2.8870    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  6  1  0
  9 11  2  0
 10 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
  2 18  1  0
 20 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 14 29  1  0
 16 30  1  0
 15 31  1  0
 31 32  2  0
 31 33  1  0
 34 33  1  0
 35 34  1  1
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 35 39  1  0
M  END

Associated Targets(Human)

RIOK2 Tbio Serine/threonine-protein kinase RIO2 (621 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 506.61Molecular Weight (Monoisotopic): 506.2430AlogP: 4.46#Rotatable Bonds: 6
Polar Surface Area: 103.84Molecular Species: BASEHBA: 5HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.27CX Basic pKa: 10.47CX LogP: 3.55CX LogD: 0.99
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -0.89

References

1.  (2014)  3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 
2.  (2019)  3-(aryl or heteroaryl) methyleneindolin-2-one derivatives as inhibitors of cancer stem cell pathway kinases for the treatment of cancer, 

Source