The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Tetrahydrofuran-3-ylmethyl 3-{[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonyl]amino}benzoate ID: ALA3729289
PubChem CID: 66799721
Max Phase: Preclinical
Molecular Formula: C21H20ClNO5S2
Molecular Weight: 465.98
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(S(=O)(=O)Nc2cccc(C(=O)OCC3CCOC3)c2)sc2ccc(Cl)cc12
Standard InChI: InChI=1S/C21H20ClNO5S2/c1-13-18-10-16(22)5-6-19(18)29-21(13)30(25,26)23-17-4-2-3-15(9-17)20(24)28-12-14-7-8-27-11-14/h2-6,9-10,14,23H,7-8,11-12H2,1H3
Standard InChI Key: SDTHLKRTGUZOBQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
4.6750 1.0813 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0351 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2871 0.0494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3539 -1.2384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1214 -2.5273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6212 -2.5071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3537 -1.1981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5864 0.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0865 0.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8532 -1.2555 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0907 -2.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 -1.3452 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.3917 -3.7951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8075 -4.8433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8923 -3.7728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6628 -5.0608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1634 -5.0385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0437 -6.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4622 -5.7498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4369 -4.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0026 -3.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 10 1 0
10 2 1 0
2 11 1 0
11 12 1 0
12 15 1 0
14 13 1 0
13 11 2 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
13 20 1 0
18 21 1 0
6 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.98Molecular Weight (Monoisotopic): 465.0471AlogP: 4.86#Rotatable Bonds: 6Polar Surface Area: 81.70Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.25CX Basic pKa: ┄CX LogP: 4.64CX LogD: 3.88Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.53Np Likeness Score: -1.22