The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-benzyl-2,4-dihydroxy-N-(4-(2-phenylacetamido)phenyl)benzamide ID: ALA3729408
PubChem CID: 117972710
Max Phase: Preclinical
Molecular Formula: C28H24N2O4
Molecular Weight: 452.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Cc1ccccc1)Nc1ccc(N(Cc2ccccc2)C(=O)c2ccc(O)cc2O)cc1
Standard InChI: InChI=1S/C28H24N2O4/c31-24-15-16-25(26(32)18-24)28(34)30(19-21-9-5-2-6-10-21)23-13-11-22(12-14-23)29-27(33)17-20-7-3-1-4-8-20/h1-16,18,31-32H,17,19H2,(H,29,33)
Standard InChI Key: MCVLNBFHTGVRFR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8964 -0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1931 -1.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1885 -3.0094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8871 -3.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5904 -3.0014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -1.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8007 1.4864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0971 0.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0919 -0.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7903 -1.5136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4939 -0.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8793 -5.2562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5762 -6.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5399 -5.3957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5684 -7.5015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2653 -8.2460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2554 -9.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0486 -10.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3427 -9.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3328 -8.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0289 -7.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
1 7 1 0
3 8 1 0
4 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 1 0
11 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
13 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 13 1 0
17 25 1 0
25 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.51Molecular Weight (Monoisotopic): 452.1736AlogP: 5.13#Rotatable Bonds: 7Polar Surface Area: 89.87Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.83CX Basic pKa: ┄CX LogP: 5.12CX LogD: 4.98Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.36Np Likeness Score: -1.11
References 1. (2015) Resorcinol n-aryl amide compounds, for use as pyruvate dehydrogenase kinase inhibitors,