N-3-(1H-Tetrazol-5-yl)phenyl]biphenyl-3-sulfonamide

ID: ALA3729559

PubChem CID: 56943089

Max Phase: Preclinical

Molecular Formula: C19H15N5O2S

Molecular Weight: 377.43

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  O=S(=O)(Nc1cccc(-c2nnn[nH]2)c1)c1cccc(-c2ccccc2)c1

Standard InChI:  InChI=1S/C19H15N5O2S/c25-27(26,18-11-5-8-15(13-18)14-6-2-1-3-7-14)22-17-10-4-9-16(12-17)19-20-23-24-21-19/h1-13,22H,(H,20,21,23,24)

Standard InChI Key:  FRGRLULPHNFQGA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
    1.5548   -3.6021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.5568   -2.4023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987   -1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9511   -0.8815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9530   -1.9978    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2010   -3.2957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7343   -2.9815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8933   -3.7570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8902   -5.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1877   -6.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4883   -5.2623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4914   -3.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1939   -3.0097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7926   -3.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0914   -3.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3908   -3.0158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3915   -1.5158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0928   -0.7652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7934   -1.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  9 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  1  0
  2 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 20 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
M  END

Alternative Forms

Associated Targets(Human)

PFKFB4 Tchem 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 4 (37 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 377.43Molecular Weight (Monoisotopic): 377.0946AlogP: 3.33#Rotatable Bonds: 5
Polar Surface Area: 100.63Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.28CX Basic pKa: CX LogP: 3.39CX LogD: 1.64
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.56Np Likeness Score: -1.95

References

1.  (2012)  New compounds, 
2.  (2016)  Sulfonamide compounds,