N-(4-(2-chloro-5-methylpyrimidin-4-yl)phenyl)-2,4-dihydroxy-N-(3-(2-morpholinoethoxy)benzyl)benzamide

ID: ALA3730054

PubChem CID: 117972697

Max Phase: Preclinical

Molecular Formula: C31H31ClN4O5

Molecular Weight: 575.07

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cnc(Cl)nc1-c1ccc(N(Cc2cccc(OCCN3CCOCC3)c2)C(=O)c2ccc(O)cc2O)cc1

Standard InChI:  InChI=1S/C31H31ClN4O5/c1-21-19-33-31(32)34-29(21)23-5-7-24(8-6-23)36(30(39)27-10-9-25(37)18-28(27)38)20-22-3-2-4-26(17-22)41-16-13-35-11-14-40-15-12-35/h2-10,17-19,37-38H,11-16,20H2,1H3

Standard InChI Key:  LNBYJUPTVFIGQB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   -3.9126    8.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6114    7.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6071    6.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9040    5.2471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2052    5.9934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2095    7.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9160    9.4471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5662    5.4038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9028    3.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8629    3.1474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2015    2.9940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2003    1.4932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4990    0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5020    3.7429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8014    2.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1002    3.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0999    5.2437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8006    5.9933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5018    5.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8007    1.4864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0971    0.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.0919   -0.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7903   -1.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4939   -0.7591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3993    5.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.3967    7.4944    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6944    8.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9948    7.4992    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -12.9975    5.9992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6999    5.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7021    4.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.6922    9.4468    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -7.7820   -3.0144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4786   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4703   -5.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1669   -6.0033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1565   -7.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8523   -8.2443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5584   -7.4854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5688   -5.9854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8730   -5.2444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  1  7  1  0
  3  8  1  0
  4  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 11 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 13  1  0
 17 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 30 31  1  0
 27 32  1  0
 23 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 36 41  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
M  END

Associated Targets(Human)

PDK1 Tchem Pyruvate dehydrogenase kinase isoform 1 (2021 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDK2 Tchem Pyruvate dehydrogenase kinase (522 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 575.07Molecular Weight (Monoisotopic): 574.1983AlogP: 5.07#Rotatable Bonds: 9
Polar Surface Area: 108.25Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.85CX Basic pKa: 6.63CX LogP: 5.00CX LogD: 5.01
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.27Np Likeness Score: -1.37

References

1.  (2015)  Resorcinol n-aryl amide compounds, for use as pyruvate dehydrogenase kinase inhibitors, 
2. Morrell, J A JA and 5 more authors.  2003-12  AZD7545 is a selective inhibitor of pyruvate dehydrogenase kinase 2.  [PMID:14641019]
3. Meng, Tao T and 10 more authors.  2014-12-11  Discovery and optimization of 4,5-diarylisoxazoles as potent dual inhibitors of pyruvate dehydrogenase kinase and heat shock protein 90.  [PMID:25383915]
4. Moore, Jonathan D and 12 more authors.  2014-12-30  VER-246608, a novel pan-isoform ATP competitive inhibitor of pyruvate dehydrogenase kinase, disrupts Warburg metabolism and induces context-dependent cytostasis in cancer cells.  [PMID:25404640]
5. Narayan, Satya S and 7 more authors.  2019-01-01  ASR352, A potent anticancer agent: Synthesis, preliminary SAR, and biological activities against colorectal cancer bulk, 5-fluorouracil/oxaliplatin resistant and stem cells.  [PMID:30384048]

Source