(R)-1-Phenyl-2-{4-[4-((R)-pyrrolidin-3-ylamino)-thieno[3,2-d]pyrimidin-2-yl]-pyridin-2-ylamino}-ethanol

ID: ALA3730161

PubChem CID: 89596372

Max Phase: Preclinical

Molecular Formula: C23H24N6OS

Molecular Weight: 432.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O[C@@H](CNc1cc(-c2nc(N[C@@H]3CCNC3)c3sccc3n2)ccn1)c1ccccc1

Standard InChI:  InChI=1S/C23H24N6OS/c30-19(15-4-2-1-3-5-15)14-26-20-12-16(6-10-25-20)22-28-18-8-11-31-21(18)23(29-22)27-17-7-9-24-13-17/h1-6,8,10-12,17,19,24,30H,7,9,13-14H2,(H,25,26)(H,27,28,29)/t17-,19+/m1/s1

Standard InChI Key:  OCGADBCHKGCNJO-MJGOQNOKSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -1.0028   -1.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9971    3.0138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2151   -1.4892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6204   -2.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9144   -0.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9211   -3.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2935    3.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2185   -2.9892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168   -1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4279    5.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8944    5.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6474    4.2692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6464    3.1521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9214   -5.2429    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6222   -5.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6225   -7.4952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3234   -8.2467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3215   -9.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0215  -10.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2766   -9.7435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2748   -8.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0252   -7.4951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6620   -8.0947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  1  0
  6 14  2  0
  5  4  1  0
  8 16  1  0
  4  3  2  0
 17 11  2  0
  3  8  1  0
 15 12  1  0
 16  5  2  0
 14  2  1  0
  1  7  2  0
 12 10  2  0
 13  2  1  1
 10 17  1  0
  9 15  2  0
 14  3  1  0
 11  9  1  0
  7 17  1  0
  7  6  1  0
 13 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 13  1  0
 12 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 24 31  1  1
M  END

Associated Targets(Human)

PRKCI Tchem Protein kinase C iota (2821 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 432.55Molecular Weight (Monoisotopic): 432.1732AlogP: 3.67#Rotatable Bonds: 7
Polar Surface Area: 94.99Molecular Species: BASEHBA: 8HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 10.31CX LogP: 3.42CX LogD: 0.64
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.35Np Likeness Score: -1.31

References

1.  (2013)  Thienopyrimidine inhibitors of atypical protein kinase C, 

Source