The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Thiophene-2-carboxylic acid{4-[4-((3S,4S)-4-hydroxy-pyrrolidin-3-ylamino)-thieno[3,2-d]pyrimidin-2-yl]-pyridin-2-yl}-amide ID: ALA3730182
PubChem CID: 89596270
Max Phase: Preclinical
Molecular Formula: C20H18N6O2S2
Molecular Weight: 438.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc(-c2nc(N[C@H]3CNC[C@@H]3O)c3sccc3n2)ccn1)c1cccs1
Standard InChI: InChI=1S/C20H18N6O2S2/c27-14-10-21-9-13(14)24-19-17-12(4-7-30-17)23-18(26-19)11-3-5-22-16(8-11)25-20(28)15-2-1-6-29-15/h1-8,13-14,21,27H,9-10H2,(H,22,25,28)(H,23,24,26)/t13-,14-/m0/s1
Standard InChI Key: PANQXVXSWCKSOI-KBPBESRZSA-N
Molfile:
RDKit 2D
30 34 0 0 0 0 0 0 0 0999 V2000
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2935 -3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4279 -5.2511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8944 -5.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6474 -4.2692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6464 -3.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9144 0.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2151 1.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2185 2.9892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9211 3.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6204 2.9950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9214 5.2429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5295 -6.0466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6222 5.9944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6225 7.4952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5827 5.3949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4109 8.3577 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.8776 9.7833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3776 9.7799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8380 8.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
11 10 1 6
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
2 16 1 0
20 22 1 0
12 23 1 1
22 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 25 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.54Molecular Weight (Monoisotopic): 438.0933AlogP: 2.81#Rotatable Bonds: 5Polar Surface Area: 112.06Molecular Species: BASEHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.38CX Basic pKa: 9.59CX LogP: 3.04CX LogD: 0.87Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: -1.68
References 1. (2013) Thienopyrimidine inhibitors of atypical protein kinase C,