The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[2-cyclopropyl-6-[4-(2-methoxyethyl)-2-methyl-piperazin-1-yl]pyrimidin-4-yl]-3-(difluoromethoxy)pyridin-2-amine ID: ALA3730191
PubChem CID: 117688690
Max Phase: Preclinical
Molecular Formula: C21H28F2N6O2
Molecular Weight: 434.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COCCN1CCN(c2cc(-c3cnc(N)c(OC(F)F)c3)nc(C3CC3)n2)C(C)C1
Standard InChI: InChI=1S/C21H28F2N6O2/c1-13-12-28(7-8-30-2)5-6-29(13)18-10-16(26-20(27-18)14-3-4-14)15-9-17(31-21(22)23)19(24)25-11-15/h9-11,13-14,21H,3-8,12H2,1-2H3,(H2,24,25)
Standard InChI Key: STVDXMOVKVJSHD-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5939 6.0054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6035 5.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2783 7.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0242 5.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8955 5.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1921 6.0137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 7.5137 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8859 8.2596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5893 7.5054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4831 8.2709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4762 9.7717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7720 10.5289 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7665 11.7289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9395 -1.3434 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 0.4545 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8993 4.0596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 8 1 0
5 14 1 0
10 15 1 0
12 16 1 0
17 16 1 0
18 17 1 0
16 18 1 0
15 19 1 0
15 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
21 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
14 28 1 0
28 29 1 0
28 30 1 0
19 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.49Molecular Weight (Monoisotopic): 434.2242AlogP: 2.76#Rotatable Bonds: 8Polar Surface Area: 89.63Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.75CX LogP: 3.48CX LogD: 2.97Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.68Np Likeness Score: -1.42
References 1. (2014) Biheteroaryl compounds and uses thereof, 2. (2014) Biheteroaryl compounds and uses thereof,