The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Thiophene-2-carboxylic acid(4-{4-[(S)-2-amino-3-(4-trifluoromethyl-phenyl)-propylamino]-thieno[3,2-d]pyrimidin-2-yl}-pyridin-2-yl)-amide ID: ALA3730235
PubChem CID: 89596568
Max Phase: Preclinical
Molecular Formula: C26H21F3N6OS2
Molecular Weight: 554.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N[C@H](CNc1nc(-c2ccnc(NC(=O)c3cccs3)c2)nc2ccsc12)Cc1ccc(C(F)(F)F)cc1
Standard InChI: InChI=1S/C26H21F3N6OS2/c27-26(28,29)17-5-3-15(4-6-17)12-18(30)14-32-24-22-19(8-11-38-22)33-23(35-24)16-7-9-31-21(13-16)34-25(36)20-2-1-10-37-20/h1-11,13,18H,12,14,30H2,(H,31,34,36)(H,32,33,35)/t18-/m0/s1
Standard InChI Key: GYKCIVWHQBSEHL-SFHVURJKSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-1.0028 1.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9144 0.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2151 1.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2185 2.9892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9211 3.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6204 2.9950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2935 -3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2878 -5.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5842 -6.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2461 -5.8665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5785 -7.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8731 -8.2854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8643 -9.7854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5609 -10.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2663 -9.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2750 -8.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5521 -12.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5874 -12.6353 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5092 -12.6222 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.5445 -13.2286 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.5147 0.7385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.8151 1.4879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8157 2.6879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.1147 0.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4675 1.3552 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-12.4687 0.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7158 -1.0591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.2493 -0.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
4 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
2 11 1 0
10 17 1 0
17 18 1 0
18 19 1 0
18 20 1 1
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
13 31 1 0
31 32 1 0
32 33 2 0
32 34 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.62Molecular Weight (Monoisotopic): 554.1170AlogP: 6.07#Rotatable Bonds: 8Polar Surface Area: 105.82Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.46CX Basic pKa: 9.60CX LogP: 6.33CX LogD: 4.17Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: -1.78
References 1. (2013) Thienopyrimidine inhibitors of atypical protein kinase C,