Thiophene-2-carboxylic acid(4-{4-[(S)-2-amino-3-(4-trifluoromethyl-phenyl)-propylamino]-thieno[3,2-d]pyrimidin-2-yl}-pyridin-2-yl)-amide

ID: ALA3730235

PubChem CID: 89596568

Max Phase: Preclinical

Molecular Formula: C26H21F3N6OS2

Molecular Weight: 554.62

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N[C@H](CNc1nc(-c2ccnc(NC(=O)c3cccs3)c2)nc2ccsc12)Cc1ccc(C(F)(F)F)cc1

Standard InChI:  InChI=1S/C26H21F3N6OS2/c27-26(28,29)17-5-3-15(4-6-17)12-18(30)14-32-24-22-19(8-11-38-22)33-23(35-24)16-7-9-31-21(13-16)34-25(36)20-2-1-10-37-20/h1-11,13,18H,12,14,30H2,(H,31,34,36)(H,32,33,35)/t18-/m0/s1

Standard InChI Key:  GYKCIVWHQBSEHL-SFHVURJKSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -1.0028    1.5132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9971   -3.0138    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168    1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9144    0.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2151    1.4892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2185    2.9892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9211    3.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6204    2.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2935   -3.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2878   -5.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5842   -6.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2461   -5.8665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5785   -7.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8731   -8.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8643   -9.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5609  -10.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2663   -9.7702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2750   -8.2702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5521  -12.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5874  -12.6353    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5092  -12.6222    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5445  -13.2286    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5147    0.7385    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8151    1.4879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8157    2.6879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1147    0.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4675    1.3552    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
  -12.4687    0.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.7158   -1.0591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2493   -0.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  4 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  2 11  1  0
 10 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  1
 19 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
 13 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 34  2  0
M  END

Associated Targets(Human)

PRKCI Tchem Protein kinase C iota (2821 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 554.62Molecular Weight (Monoisotopic): 554.1170AlogP: 6.07#Rotatable Bonds: 8
Polar Surface Area: 105.82Molecular Species: BASEHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.46CX Basic pKa: 9.60CX LogP: 6.33CX LogD: 4.17
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.22Np Likeness Score: -1.78

References

1.  (2013)  Thienopyrimidine inhibitors of atypical protein kinase C, 

Source