Phenyl 3-{[(5-chloro-3-methyl-1-benzothiophen-2-yl)sulfonyl]amino}benzoate

ID: ALA3730263

PubChem CID: 66799888

Max Phase: Preclinical

Molecular Formula: C22H16ClNO4S2

Molecular Weight: 457.96

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(S(=O)(=O)Nc2cccc(C(=O)Oc3ccccc3)c2)sc2ccc(Cl)cc12

Standard InChI:  InChI=1S/C22H16ClNO4S2/c1-14-19-13-16(23)10-11-20(19)29-22(14)30(26,27)24-17-7-5-6-15(12-17)21(25)28-18-8-3-2-4-9-18/h2-13,24H,1H3

Standard InChI Key:  AFRAPZRZQPCSNB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    4.6750    1.0813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0351    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2871    0.0494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3539   -1.2384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1214   -2.5273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6212   -2.5071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3537   -1.1981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5864    0.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0865    0.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8532   -1.2555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907   -2.3426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3560   -1.3452    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    9.3917   -3.7951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8075   -4.8433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8923   -3.7728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6628   -5.0608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1627   -5.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9301   -6.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1976   -7.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6977   -7.6587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9303   -6.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4 10  1  0
 10  2  1  0
  2 11  1  0
 11 12  1  0
 12 15  1  0
 14 13  1  0
 13 11  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  1  0
 18 21  1  0
  6 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
M  END

Associated Targets(Human)

PFKFB3 Tchem fructose-2,6-bisphosphatase 3/4 (29 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 457.96Molecular Weight (Monoisotopic): 457.0209AlogP: 5.88#Rotatable Bonds: 5
Polar Surface Area: 72.47Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.25CX Basic pKa: CX LogP: 6.28CX LogD: 5.52
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.30Np Likeness Score: -1.45

References

1.  (2012)  New compounds, 

Source