N-cyclopropyl-4-[6-[4-(4-isopropylpiperazin-1-yl)phenyl]imidazo[1,2-a]pyrazin-3-yl]benzamide

ID: ALA3730393

PubChem CID: 117770448

Max Phase: Preclinical

Molecular Formula: C29H32N6O

Molecular Weight: 480.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)N1CCN(c2ccc(-c3cn4c(-c5ccc(C(=O)NC6CC6)cc5)cnc4cn3)cc2)CC1

Standard InChI:  InChI=1S/C29H32N6O/c1-20(2)33-13-15-34(16-14-33)25-11-7-21(8-12-25)26-19-35-27(17-31-28(35)18-30-26)22-3-5-23(6-4-22)29(36)32-24-9-10-24/h3-8,11-12,17-20,24H,9-10,13-16H2,1-2H3,(H,32,36)

Standard InChI Key:  INTJGHUSNHHTMM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1749    2.6315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2517    3.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8114    5.1995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2965    5.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2218    4.2301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6621    2.8384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8593    6.8019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3455    7.0110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1207    7.7476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9084    8.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0548    9.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6631    9.8025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6168    1.4950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6203    2.9951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9210    3.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2184    2.9893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2150    1.4893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9143    0.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5198    3.7367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5256    5.2368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8275    5.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1237    5.2268    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  -10.1179    3.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8160    2.9818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4278    5.9696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.4639    5.3641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4345    7.1695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  4  1  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  9 10  1  0
 13 16  1  0
 16 17  1  0
 16 18  2  0
 17 19  1  0
 20 19  1  0
 21 20  1  0
 19 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  1 22  1  0
 28 29  1  0
 28 33  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 25 28  1  0
 31 34  1  0
 34 35  1  0
 34 36  1  0
M  END

Associated Targets(non-human)

Beta-TC6 (562 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.62Molecular Weight (Monoisotopic): 480.2638AlogP: 4.49#Rotatable Bonds: 6
Polar Surface Area: 65.77Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.37CX LogP: 3.41CX LogD: 2.39
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.44Np Likeness Score: -1.49

References

1.  (2014)  Nitrogen bicyclic compounds as inhibitors for Scyl1 and Grk5, 

Source