2-(2-Chloro-phenylimino)-5-quinolin-6-ylmethylene-thiazolidin-4-one

ID: ALA3730504

PubChem CID: 135500040

Max Phase: Preclinical

Molecular Formula: C19H12ClN3OS

Molecular Weight: 365.85

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1N/C(=N/c2ccccc2Cl)S/C1=C\c1ccc2ncccc2c1

Standard InChI:  InChI=1S/C19H12ClN3OS/c20-14-5-1-2-6-16(14)22-19-23-18(24)17(25-19)11-12-7-8-15-13(10-12)4-3-9-21-15/h1-11H,(H,22,23,24)/b17-11-

Standard InChI Key:  FITCFFSJDIRDTL-BOPFTXTBSA-N

Molfile:  

     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9122    1.4966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2109    0.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3439   -0.7369    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8101   -1.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5644    0.2430    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5644    1.3610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8108    2.5355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4178   -2.4230    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5350   -3.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0435   -3.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1587   -4.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7652   -6.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2566   -6.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1414   -5.0087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3345   -5.1373    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  5  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
  3 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 16 17  2  0
 14 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 24 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3730504

    ---

Associated Targets(Human)

DYRK3 Tchem Dual-specificity tyrosine-phosphorylation regulated kinase 3 (1018 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 365.85Molecular Weight (Monoisotopic): 365.0390AlogP: 4.78#Rotatable Bonds: 2
Polar Surface Area: 54.35Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.85CX Basic pKa: 4.44CX LogP: 4.67CX LogD: 4.67
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.66Np Likeness Score: -1.82

References

1.  (2010)  Chemical compounds, 

Source