The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[6-(azetidin-1-yl)-2-cyclopropyl-pyrimidin-4-yl]-3-[1-(4-methylthiazol-2-yl)ethoxy]pyridin-2-amine ID: ALA3730558
PubChem CID: 117688597
Max Phase: Preclinical
Molecular Formula: C21H24N6OS
Molecular Weight: 408.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1csc(C(C)Oc2cc(-c3cc(N4CCC4)nc(C4CC4)n3)cnc2N)n1
Standard InChI: InChI=1S/C21H24N6OS/c1-12-11-29-21(24-12)13(2)28-17-8-15(10-23-19(17)22)16-9-18(27-6-3-7-27)26-20(25-16)14-4-5-14/h8-11,13-14H,3-7H2,1-2H3,(H2,22,23)
Standard InChI Key: IZSWOHGDYNYOSX-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2954 5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 6.0009 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3026 5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3002 3.7488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5939 6.0054 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9994 5.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3830 7.0459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9329 7.4295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6035 5.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2783 7.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0242 5.9469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 0.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5517 -0.8722 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.5554 -1.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8054 -3.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3382 -2.9741 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-8.7488 -1.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
3 8 1 0
5 14 1 0
14 15 1 0
10 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 16 1 0
21 20 1 0
22 21 1 0
20 22 1 0
12 20 1 0
15 23 1 0
15 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 408.53Molecular Weight (Monoisotopic): 408.1732AlogP: 4.11#Rotatable Bonds: 6Polar Surface Area: 90.05Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.70CX LogP: 3.66CX LogD: 3.65Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.66Np Likeness Score: -1.41
References 1. (2014) Biheteroaryl compounds and uses thereof, 2. (2014) Biheteroaryl compounds and uses thereof,